4-O-Methylhonokiol
| Internal ID | a82c7084-6376-44b9-beaf-f5a0aa3123e5 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives |
| IUPAC Name | 2-(4-methoxy-3-prop-2-enylphenyl)-4-prop-2-enylphenol |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C2=C(C=CC(=C2)CC=C)O)CC=C |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=C(C=CC(=C2)CC=C)O)CC=C |
| InChI | InChI=1S/C19H20O2/c1-4-6-14-8-10-18(20)17(12-14)15-9-11-19(21-3)16(13-15)7-5-2/h4-5,8-13,20H,1-2,6-7H2,3H3 |
| InChI Key | OQFHJKZVOALSPV-UHFFFAOYSA-N |
| Popularity | 55 references in papers |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 5.30 |
| 68592-15-4 |
| 4-O-Methyl honokiol |
| METHYLHONOKIOL |
| 4-methoxyhonokiol |
| 4'-O-Methylhonokiol |
| TUH6B83HJW |
| CHEMBL89700 |
| 4'-METHOXY-3',5-DI-2-PROPENYL-(1,1'-BIPHENYL)-2-OL |
| HONOKIOL MONO-METHYL ETHER |
| NSC-293101 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase |
1500 nM |
IC50 |
PMID: 19481465
|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor |
44 nM 44 nM |
Ki Ki |
PMID: 24900561
via Super-PRED |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.25% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.85% | 96.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 94.73% | 95.17% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.26% | 91.49% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 91.76% | 90.24% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.33% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.32% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.27% | 86.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.76% | 90.20% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 89.74% | 95.12% |
| CHEMBL3194 | P02766 | Transthyretin | 88.75% | 90.71% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.67% | 95.50% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 86.42% | 98.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.24% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.11% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.67% | 95.56% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.03% | 96.95% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 81.41% | 88.48% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.14% | 80.78% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.20% | 90.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.14% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 155160 |
| NPASS | NPC35344 |
| ChEMBL | CHEMBL89700 |
| LOTUS | LTS0014450 |
| wikiData | Q4637186 |