2',4'-Dihydroxydihydrochalcone
| Internal ID | 0aa650d9-e9fb-4bba-8cc7-c84a3477b35d |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxy-dihydrochalcones |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-3-phenylpropan-1-one |
| SMILES (Canonical) | C1=CC=C(C=C1)CCC(=O)C2=C(C=C(C=C2)O)O |
| SMILES (Isomeric) | C1=CC=C(C=C1)CCC(=O)C2=C(C=C(C=C2)O)O |
| InChI | InChI=1S/C15H14O3/c16-12-7-8-13(15(18)10-12)14(17)9-6-11-4-2-1-3-5-11/h1-5,7-8,10,16,18H,6,9H2 |
| InChI Key | ZUKLXLKVCGZHAA-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.094294304 g/mol |
| Topological Polar Surface Area (TPSA) | 57.50 Ų |
| XlogP | 3.30 |
| 1-(2,4-dihydroxyphenyl)-3-phenylpropan-1-one |
| 2,4-Dihydroxyphenyl-2-phenylethyl ketone |
| 1-Propanone, 1-(2,4-dihydroxyphenyl)-3-phenyl- |
| SCHEMBL7301852 |
| CHEMBL3747412 |
| LMPK12120442 |
| AKOS024367175 |
| 2',4'-Dihydroxy-alpha,beta-dihydrochalcone |
| FT-0640179 |
| 1-(2,4-dihydroxyphenyl)3-phenyl-propan-1-one |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.47% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.26% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.93% | 96.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.10% | 94.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.61% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.72% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.51% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.10% | 95.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.73% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.47% | 90.00% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 83.70% | 92.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.35% | 94.73% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.87% | 91.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.69% | 99.15% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 80.58% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 586491 |
| NPASS | NPC156139 |
| ChEMBL | CHEMBL3747412 |
| LOTUS | LTS0124650 |
| wikiData | Q105383757 |