(1R,2R,9S,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one
Internal ID | 3af548ed-8406-4ef2-a390-4ed2d4269910 |
Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Sparteine, lupanine, and related alkaloids |
IUPAC Name | (1R,2R,9S,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
SMILES (Canonical) | C1CCN2CC3CC(C2C1)CN4C3CCCC4=O |
SMILES (Isomeric) | C1CCN2C[C@H]3C[C@H]([C@H]2C1)CN4[C@@H]3CCCC4=O |
InChI | InChI=1S/C15H24N2O/c18-15-6-3-5-14-11-8-12(10-17(14)15)13-4-1-2-7-16(13)9-11/h11-14H,1-10H2/t11-,12+,13-,14-/m1/s1 |
InChI Key | JYIJIIVLEOETIQ-XJFOESAGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24N2O |
Molecular Weight | 248.36 g/mol |
Exact Mass | 248.188863393 g/mol |
Topological Polar Surface Area (TPSA) | 23.60 Ų |
XlogP | 1.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.21% | 97.25% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 92.53% | 91.76% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.41% | 97.09% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 89.64% | 94.78% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.57% | 95.56% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.86% | 93.03% |
CHEMBL2581 | P07339 | Cathepsin D | 87.81% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.76% | 91.11% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.30% | 90.71% |
CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 86.98% | 97.98% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 85.67% | 91.81% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.48% | 98.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.28% | 95.50% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.13% | 93.04% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.85% | 96.09% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 83.43% | 91.43% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.25% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.87% | 92.50% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.99% | 97.05% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 80.74% | 94.66% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 80.49% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.45% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.36% | 93.00% |
CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 80.05% | 99.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 92143189 |
LOTUS | LTS0167136 |
wikiData | Q100145877 |