Tricin 7-O-glucoside
Internal ID | 186db4c1-9421-472d-a5f3-a3a27521fd0c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O |
InChI | InChI=1S/C23H24O12/c1-31-15-3-9(4-16(32-2)19(15)27)13-7-12(26)18-11(25)5-10(6-14(18)34-13)33-23-22(30)21(29)20(28)17(8-24)35-23/h3-7,17,20-25,27-30H,8H2,1-2H3 |
InChI Key | JGXFMIJHKASCIZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H24O12 |
Molecular Weight | 492.40 g/mol |
Exact Mass | 492.12677620 g/mol |
Topological Polar Surface Area (TPSA) | 185.00 Ų |
XlogP | 0.80 |
3',5'-Dimethoxytricetin 7-O-beta-D-glucopypranoside |
Tricin 7-O-glucoside |
2,4-DICHLORO-6-(O-CHLOROPHENOXY)-S-TRIAZINE |
SCHEMBL22345059 |
SCHEMBL23764741 |
Flavone base + 3O, 2MeO, O-Hex |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.36% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.54% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.07% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.47% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.74% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.59% | 96.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.48% | 96.21% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.00% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.87% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.40% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 88.17% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.74% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.72% | 94.73% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.69% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.57% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.43% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.22% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.99% | 90.71% |
CHEMBL220 | P22303 | Acetylcholinesterase | 81.73% | 94.45% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.37% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.04% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 13984469 |
LOTUS | LTS0111978 |
wikiData | Q105127764 |