Sophoricoside
Internal ID | 4016c5e4-b35e-4cd7-b603-2fd7e5d6194b |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid O-glycosides |
IUPAC Name | 5,7-dihydroxy-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C21H20O10/c22-7-15-18(26)19(27)20(28)21(31-15)30-11-3-1-9(2-4-11)12-8-29-14-6-10(23)5-13(24)16(14)17(12)25/h1-6,8,15,18-24,26-28H,7H2/t15-,18-,19+,20-,21-/m1/s1 |
InChI Key | ISQRJFLLIDGZEP-CMWLGVBASA-N |
Popularity | 45 references in papers |
Molecular Formula | C21H20O10 |
Molecular Weight | 432.40 g/mol |
Exact Mass | 432.10564683 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 0.90 |
152-95-4 |
Genistein sophoricoside |
5,7-dihydroxy-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
Genistein sophoricoside [MI] |
5',7'-Dihydroxy-4'-glucosyloxyisoflavone |
UNII-J0407L5MGM |
CHEMBL486626 |
J0407L5MGM |
5,7-dihydroxy-3-(4-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)phenyl)-4H-chromen-4-one |
Genistein, 4'-beta-D-glucopyranoside |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
44668.4 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
35481.3 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.21% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.91% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.95% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.20% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.42% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.45% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.91% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.14% | 86.33% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 89.94% | 96.12% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.03% | 97.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.59% | 95.78% |
CHEMBL3194 | P02766 | Transthyretin | 86.16% | 90.71% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.08% | 96.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.02% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.46% | 90.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.00% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.08% | 95.93% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.48% | 95.64% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.93% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.26% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5321398 |
NPASS | NPC156457 |
ChEMBL | CHEMBL486626 |
LOTUS | LTS0231097 |
wikiData | Q7563141 |