Shikonin
| Internal ID | fd3f3a1f-89a8-4a91-9817-941514f39282 |
| Taxonomy | Benzenoids > Naphthalenes > Naphthoquinones |
| IUPAC Name | 5,8-dihydroxy-2-[(1R)-1-hydroxy-4-methylpent-3-enyl]naphthalene-1,4-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H16O5/c1-8(2)3-4-10(17)9-7-13(20)14-11(18)5-6-12(19)15(14)16(9)21/h3,5-7,10,17-19H,4H2,1-2H3/t10-/m1/s1 |
| InChI Key | NEZONWMXZKDMKF-SNVBAGLBSA-N |
| Popularity | 2,306 references in papers |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 94.80 Ų |
| XlogP | 3.00 |
| 517-89-5 |
| Isoarnebin 4 |
| Tokyo Violet |
| (R)-(+)-Shikonin |
| (+)-Shikonin |
| Shikonine |
| NSC 252844 |
| CCRIS 6492 |
| 5,8-dihydroxy-2-[(1R)-1-hydroxy-4-methylpent-3-enyl]naphthalene-1,4-dione |
| 3IK6592UBW |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
15848.9 nM |
Potency |
via CMAUP
|
| CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
10000 nM |
Potency |
via CMAUP
|
| CHEMBL3775 | P30304 | Dual specificity phosphatase Cdc25A |
220 nM |
IC50 |
via Super-PRED
|
| CHEMBL4804 | P30305 | Dual specificity phosphatase Cdc25B |
400 nM |
IC50 |
via Super-PRED
|
| CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 |
139.2 nM |
IC50 |
via Super-PRED
|
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
4466.8 nM 2238.7 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B |
25000 nM |
IC50 |
PMID: 15050628
|
| CHEMBL1075189 | P14618 | Pyruvate kinase isozymes M1/M2 |
500 nM |
IC50 |
via Super-PRED
|
| CHEMBL1293232 | Q16637 | Survival motor neuron protein |
5623.4 nM |
Potency |
via CMAUP
|
| CHEMBL1947 | P10828 | Thyroid hormone receptor beta-1 |
28183.8 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.86% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.35% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.70% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.35% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.03% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.41% | 94.73% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 84.20% | 91.38% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.05% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.96% | 99.15% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.61% | 96.67% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.49% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 479503 |
| NPASS | NPC246693 |
| ChEMBL | CHEMBL9470 |
| LOTUS | LTS0139652 |
| wikiData | Q27155024 |