DL-Tyrosine
| Internal ID | 7ae92e5f-7f3a-4df0-862c-b9392c2d0c0b |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Tyrosine and derivatives |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | C1=CC(=CC=C1CC(C(=O)O)N)O |
| SMILES (Isomeric) | C1=CC(=CC=C1CC(C(=O)O)N)O |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) |
| InChI Key | OUYCCCASQSFEME-UHFFFAOYSA-N |
| Popularity | 537 references in papers |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 83.60 Ų |
| XlogP | -2.30 |
| 556-03-6 |
| H-DL-Tyr-OH |
| 2-amino-3-(4-hydroxyphenyl)propanoic acid |
| Tyrosine, DL- |
| (.+-.)-Tyrosine |
| MFCD00063074 |
| A9BAT9B32M |
| DL-TYROSINE-BETA-13C |
| L-Tyrosine (phenol-4-13C) |
| DL-4-Hydroxyphenylalanine-15N |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.26% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.15% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.68% | 90.20% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 90.91% | 92.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.08% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.36% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.47% | 94.45% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.71% | 95.50% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.68% | 97.21% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.64% | 96.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.25% | 83.82% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.88% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.72% | 95.56% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.43% | 94.62% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.12% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 1153 |
| LOTUS | LTS0224182 |
| wikiData | Q27102882 |