Avermectin A1b
Internal ID | 67421b4b-cb29-4133-9a6b-f5635ad05c34 |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
IUPAC Name | (1'R,2R,3S,4'S,6S,8'R,10'E,12'S,13'S,14'E,16'E,20'R,21'R,24'S)-24'-hydroxy-12'-[(2R,4S,5S,6S)-5-[(2S,4S,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-21'-methoxy-3,11',13',22'-tetramethyl-2-propan-2-ylspiro[2,3-dihydropyran-6,6'-3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene]-2'-one |
SMILES (Canonical) | CC1C=CC=C2COC3C2(C(C=C(C3OC)C)C(=O)OC4CC(CC=C(C1OC5CC(C(C(O5)C)OC6CC(C(C(O6)C)O)OC)OC)C)OC7(C4)C=CC(C(O7)C(C)C)C)O |
SMILES (Isomeric) | C[C@H]1/C=C/C=C/2\CO[C@H]3[C@@]2([C@@H](C=C([C@H]3OC)C)C(=O)O[C@H]4C[C@@H](C/C=C(/[C@H]1O[C@H]5C[C@@H]([C@H]([C@@H](O5)C)O[C@H]6C[C@@H]([C@H]([C@@H](O6)C)O)OC)OC)\C)O[C@]7(C4)C=C[C@@H]([C@H](O7)C(C)C)C)O |
InChI | InChI=1S/C48H72O14/c1-25(2)41-28(5)17-18-47(62-41)23-34-20-33(61-47)16-15-27(4)42(59-39-22-37(53-10)44(31(8)57-39)60-38-21-36(52-9)40(49)30(7)56-38)26(3)13-12-14-32-24-55-45-43(54-11)29(6)19-35(46(50)58-34)48(32,45)51/h12-15,17-19,25-26,28,30-31,33-45,49,51H,16,20-24H2,1-11H3/b13-12+,27-15+,32-14+/t26-,28-,30-,31-,33+,34-,35-,36-,37-,38-,39-,40-,41+,42-,43+,44-,45+,47+,48+/m0/s1 |
InChI Key | MNRHCELBXZARFX-OVBDMLLUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H72O14 |
Molecular Weight | 873.10 g/mol |
Exact Mass | 872.49220697 g/mol |
Topological Polar Surface Area (TPSA) | 159.00 Ų |
XlogP | 4.00 |
65195-52-0 |
SCHEMBL1681177 |
CHEBI:29525 |
DTXSID401317165 |
LMPK04000021 |
Q27110119 |
(1'R,2R,3S,4'S,6S,8'R,10'E,12'S,13'S,14'E,16'E,20'R,21'R,24'S)-24'-hydroxy-12'-[(2R,4S,5S,6S)-5-[(2S,4S,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-21'-methoxy-3,11',13',22'-tetramethyl-2-propan-2-ylspiro[2,3-dihydropyran-6,6'-3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene]-2'-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.52% | 83.82% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.97% | 96.77% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.40% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.84% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.37% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.80% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.62% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.61% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.37% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.15% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.77% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.35% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.79% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.52% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.28% | 97.14% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.85% | 96.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.70% | 86.33% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.23% | 91.07% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.68% | 96.38% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.45% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.09% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.65% | 95.89% |
CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 82.65% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.69% | 90.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.55% | 97.21% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.38% | 96.43% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.57% | 95.93% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.31% | 97.28% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.23% | 92.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 9940924 |
LOTUS | LTS0127795 |
wikiData | Q27139673 |