Aquillochin
Internal ID | b73d832e-988a-4493-84d0-47cdff8a643f |
Taxonomy | Lignans, neolignans and related compounds > Coumarinolignans |
IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-9-one |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2C(OC3=C4C(=CC(=C3O2)OC)C=CC(=O)O4)CO |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C2C(OC3=C4C(=CC(=C3O2)OC)C=CC(=O)O4)CO |
InChI | InChI=1S/C21H20O9/c1-25-12-7-11(8-13(26-2)17(12)24)18-15(9-22)28-21-19-10(4-5-16(23)29-19)6-14(27-3)20(21)30-18/h4-8,15,18,22,24H,9H2,1-3H3 |
InChI Key | GZXPCBAETDEQAX-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C21H20O9 |
Molecular Weight | 416.40 g/mol |
Exact Mass | 416.11073221 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 2.10 |
B0005-189143 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.78% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.09% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.26% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.13% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.68% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.47% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.78% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.83% | 99.23% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.36% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.86% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.47% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.20% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.69% | 99.15% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.44% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.42% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brucea javanica |
Cleome viscosa |
Coptis japonica |
Firmiana simplex |
Hibiscus syriacus |
Hibiscus taiwanensis |
Mallotus apelta |
Rhododendron collettianum |
Xanthium strumarium |
PubChem | 14282064 |
LOTUS | LTS0136653 |
wikiData | Q104399816 |