Anthragallol
Internal ID | 346ff8db-671b-45b5-8316-28f8e08115d9 |
Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Hydroxyanthraquinones |
IUPAC Name | 1,2,3-trihydroxyanthracene-9,10-dione |
SMILES (Canonical) | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)O |
SMILES (Isomeric) | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)O |
InChI | InChI=1S/C14H8O5/c15-9-5-8-10(14(19)13(9)18)12(17)7-4-2-1-3-6(7)11(8)16/h1-5,15,18-19H |
InChI Key | AHKDJQYHVWSRLT-UHFFFAOYSA-N |
Popularity | 128 references in papers |
Molecular Formula | C14H8O5 |
Molecular Weight | 256.21 g/mol |
Exact Mass | 256.03717335 g/mol |
Topological Polar Surface Area (TPSA) | 94.80 Ų |
XlogP | 2.40 |
Atomic LogP (AlogP) | 1.58 |
H-Bond Acceptor | 5 |
H-Bond Donor | 3 |
Rotatable Bonds | 0 |
602-64-2 |
Anthracene brown |
Anthragallic acid |
1,2,3-Trihydroxyanthraquinone |
Antragallol |
Alizarine Brown HD |
Alizarine Brown R |
Anthracene Brown G |
Anthracene Brown N |
Anthracene Brown S |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9440 | 94.40% |
Caco-2 | - | 0.6984 | 69.84% |
Blood Brain Barrier | - | 0.7250 | 72.50% |
Human oral bioavailability | + | 0.8143 | 81.43% |
Subcellular localzation | Mitochondria | 0.6168 | 61.68% |
OATP2B1 inhibitior | - | 0.6949 | 69.49% |
OATP1B1 inhibitior | + | 0.9188 | 91.88% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.8600 | 86.00% |
OCT2 inhibitior | - | 0.9750 | 97.50% |
BSEP inhibitior | - | 0.9137 | 91.37% |
P-glycoprotein inhibitior | - | 0.9496 | 94.96% |
P-glycoprotein substrate | - | 0.9834 | 98.34% |
CYP3A4 substrate | - | 0.6549 | 65.49% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8234 | 82.34% |
CYP3A4 inhibition | - | 0.7561 | 75.61% |
CYP2C9 inhibition | - | 0.5531 | 55.31% |
CYP2C19 inhibition | - | 0.9382 | 93.82% |
CYP2D6 inhibition | - | 0.8606 | 86.06% |
CYP1A2 inhibition | + | 0.7851 | 78.51% |
CYP2C8 inhibition | - | 0.8927 | 89.27% |
CYP inhibitory promiscuity | - | 0.7853 | 78.53% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.8875 | 88.75% |
Carcinogenicity (trinary) | Non-required | 0.4953 | 49.53% |
Eye corrosion | - | 0.9927 | 99.27% |
Eye irritation | + | 0.9879 | 98.79% |
Skin irritation | + | 0.7486 | 74.86% |
Skin corrosion | - | 0.8518 | 85.18% |
Ames mutagenesis | + | 0.9300 | 93.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.8731 | 87.31% |
Micronuclear | + | 0.8400 | 84.00% |
Hepatotoxicity | + | 0.7125 | 71.25% |
skin sensitisation | + | 0.5730 | 57.30% |
Respiratory toxicity | + | 0.5444 | 54.44% |
Reproductive toxicity | - | 0.6556 | 65.56% |
Mitochondrial toxicity | + | 0.5750 | 57.50% |
Nephrotoxicity | + | 0.4623 | 46.23% |
Acute Oral Toxicity (c) | III | 0.6165 | 61.65% |
Estrogen receptor binding | + | 0.8030 | 80.30% |
Androgen receptor binding | + | 0.7214 | 72.14% |
Thyroid receptor binding | - | 0.4940 | 49.40% |
Glucocorticoid receptor binding | + | 0.9138 | 91.38% |
Aromatase binding | + | 0.6800 | 68.00% |
PPAR gamma | + | 0.7934 | 79.34% |
Honey bee toxicity | - | 0.9208 | 92.08% |
Biodegradation | - | 0.9250 | 92.50% |
Crustacea aquatic toxicity | - | 0.5500 | 55.00% |
Fish aquatic toxicity | + | 0.9820 | 98.20% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4860 | P10415 | Apoptosis regulator Bcl-2 |
1325 nM 583 nM |
Ki Ki |
PMID: 24095762
PMID: 23167494 |
CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 |
1211 nM 270 nM |
Ki Ki |
PMID: 24095762
PMID: 23167494 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.80% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.80% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 97.24% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.94% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.47% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.45% | 99.15% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.25% | 82.69% |
CHEMBL2535 | P11166 | Glucose transporter | 87.18% | 98.75% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 84.48% | 96.67% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.73% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.59% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.40% | 90.71% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.18% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Coprosma lucida |
Croton steenkampianus |
Daphne aurantiaca |
Garcinia cantleyana |
Hymenodictyon orixense |
Lonicera korolkowii |
Philotheca brucei |
Portulaca pilosa |
Pteridium aquilinum |
Rubia tinctorum |
PubChem | 11768 |
NPASS | NPC203063 |
ChEMBL | CHEMBL192032 |
LOTUS | LTS0247322 |
wikiData | Q5413057 |