6-Epiharpagide
Internal ID | 480943b9-6efd-476f-bc7c-b0eda0c6ac18 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | 7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4a,5,7-triol |
SMILES (Canonical) | CC1(CC(C2(C1C(OC=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O)O |
SMILES (Isomeric) | CC1(CC(C2(C1C(OC=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O)O |
InChI | InChI=1S/C15H24O10/c1-14(21)4-7(17)15(22)2-3-23-13(11(14)15)25-12-10(20)9(19)8(18)6(5-16)24-12/h2-3,6-13,16-22H,4-5H2,1H3 |
InChI Key | XUWSHXDEJOOIND-UHFFFAOYSA-N |
Popularity | 51 references in papers |
Molecular Formula | C15H24O10 |
Molecular Weight | 364.34 g/mol |
Exact Mass | 364.13694696 g/mol |
Topological Polar Surface Area (TPSA) | 169.00 Ų |
XlogP | -3.30 |
6-Epiharpagide |
86362-16-5 |
6926-08-5 |
CID 21604821 |
CID 10044294 |
(1R,4Ar,5S,7R)-7-methyl-1-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4a,5,7-triol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.32% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.95% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.26% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.49% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.26% | 95.93% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.19% | 96.61% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.84% | 96.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.18% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.82% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.72% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.09% | 95.83% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.83% | 89.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.48% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 4678529 |
LOTUS | LTS0155662 |
wikiData | Q105342673 |