5-[(E)-3-methoxyprop-1-enyl]-3-(4-prop-2-enylphenoxy)benzene-1,2-diol
Internal ID | e9628a53-70b1-47d3-abc8-d4e5ef256b4d |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Diphenylethers |
IUPAC Name | 5-[(E)-3-methoxyprop-1-enyl]-3-(4-prop-2-enylphenoxy)benzene-1,2-diol |
SMILES (Canonical) | COCC=CC1=CC(=C(C(=C1)OC2=CC=C(C=C2)CC=C)O)O |
SMILES (Isomeric) | COC/C=C/C1=CC(=C(C(=C1)OC2=CC=C(C=C2)CC=C)O)O |
InChI | InChI=1S/C19H20O4/c1-3-5-14-7-9-16(10-8-14)23-18-13-15(6-4-11-22-2)12-17(20)19(18)21/h3-4,6-10,12-13,20-21H,1,5,11H2,2H3/b6-4+ |
InChI Key | CEMQKDFRANAKRT-GQCTYLIASA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H20O4 |
Molecular Weight | 312.40 g/mol |
Exact Mass | 312.13615911 g/mol |
Topological Polar Surface Area (TPSA) | 58.90 Ų |
XlogP | 4.10 |
There are no found synonyms. |
![2D Structure of 5-[(E)-3-methoxyprop-1-enyl]-3-(4-prop-2-enylphenoxy)benzene-1,2-diol 2D Structure of 5-[(E)-3-methoxyprop-1-enyl]-3-(4-prop-2-enylphenoxy)benzene-1,2-diol](https://plantaedb.com/storage/docs/compounds/2023/07/5-e-3-methoxyprop-1-enyl-3-4-prop-2-enylphenoxybenzene-12-diol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.57% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.65% | 91.49% |
CHEMBL240 | Q12809 | HERG | 93.84% | 89.76% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.02% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.31% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 92.29% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.17% | 96.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 91.59% | 90.24% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.51% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.08% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.88% | 99.17% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.73% | 95.17% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 90.31% | 92.68% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.70% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.47% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 84.41% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.10% | 94.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.64% | 91.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.20% | 99.15% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.17% | 96.95% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.81% | 83.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.