4-Aminobutanoate
Internal ID | 67bdb83c-cd29-4b5c-8262-c5ff72fa4898 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Amino acids and derivatives > Gamma amino acids and derivatives |
IUPAC Name | 4-azaniumylbutanoate |
SMILES (Canonical) | C(CC(=O)[O-])C[NH3+] |
SMILES (Isomeric) | C(CC(=O)[O-])C[NH3+] |
InChI | InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7) |
InChI Key | BTCSSZJGUNDROE-UHFFFAOYSA-N |
Popularity | 198 references in papers |
Molecular Formula | C4H9NO2 |
Molecular Weight | 103.12 g/mol |
Exact Mass | 103.063328530 g/mol |
Topological Polar Surface Area (TPSA) | 67.80 Ų |
XlogP | -2.50 |
Atomic LogP (AlogP) | -2.24 |
H-Bond Acceptor | 2 |
H-Bond Donor | 1 |
Rotatable Bonds | 3 |
4-aminobutanoate |
4-aminobutyrate |
gamma-aminobutyrate |
4euo |
4-ammoniobutanoate |
gamma-amino-N-butyrate |
g-amino-n-butyric acid |
3ip9 |
D04QAC |
CHEBI:59888 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9714 | 97.14% |
Caco-2 | + | 0.5000 | 50.00% |
Blood Brain Barrier | + | 0.8250 | 82.50% |
Human oral bioavailability | - | 0.7143 | 71.43% |
Subcellular localzation | Lysosomes | 0.5143 | 51.43% |
OATP2B1 inhibitior | - | 0.8491 | 84.91% |
OATP1B1 inhibitior | + | 0.9317 | 93.17% |
OATP1B3 inhibitior | + | 0.9497 | 94.97% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 0.8000 | 80.00% |
BSEP inhibitior | - | 0.9460 | 94.60% |
P-glycoprotein inhibitior | - | 0.9870 | 98.70% |
P-glycoprotein substrate | - | 0.9820 | 98.20% |
CYP3A4 substrate | - | 0.7152 | 71.52% |
CYP2C9 substrate | - | 0.5966 | 59.66% |
CYP2D6 substrate | - | 0.8246 | 82.46% |
CYP3A4 inhibition | - | 0.9607 | 96.07% |
CYP2C9 inhibition | - | 0.9343 | 93.43% |
CYP2C19 inhibition | - | 0.9559 | 95.59% |
CYP2D6 inhibition | - | 0.9432 | 94.32% |
CYP1A2 inhibition | - | 0.7625 | 76.25% |
CYP2C8 inhibition | - | 0.9828 | 98.28% |
CYP inhibitory promiscuity | - | 0.9565 | 95.65% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.6220 | 62.20% |
Carcinogenicity (trinary) | Non-required | 0.6771 | 67.71% |
Eye corrosion | + | 0.7869 | 78.69% |
Eye irritation | + | 0.9152 | 91.52% |
Skin irritation | + | 0.6181 | 61.81% |
Skin corrosion | + | 0.7811 | 78.11% |
Ames mutagenesis | - | 0.7200 | 72.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.8115 | 81.15% |
Micronuclear | - | 0.8300 | 83.00% |
Hepatotoxicity | + | 0.5375 | 53.75% |
skin sensitisation | - | 0.9330 | 93.30% |
Respiratory toxicity | - | 0.5000 | 50.00% |
Reproductive toxicity | - | 0.8222 | 82.22% |
Mitochondrial toxicity | + | 0.5875 | 58.75% |
Nephrotoxicity | + | 0.6199 | 61.99% |
Acute Oral Toxicity (c) | III | 0.5212 | 52.12% |
Estrogen receptor binding | - | 0.9546 | 95.46% |
Androgen receptor binding | - | 0.9348 | 93.48% |
Thyroid receptor binding | - | 0.9144 | 91.44% |
Glucocorticoid receptor binding | - | 0.8702 | 87.02% |
Aromatase binding | - | 0.8738 | 87.38% |
PPAR gamma | - | 0.7849 | 78.49% |
Honey bee toxicity | - | 0.9619 | 96.19% |
Biodegradation | + | 0.8500 | 85.00% |
Crustacea aquatic toxicity | - | 0.7400 | 74.00% |
Fish aquatic toxicity | - | 0.9759 | 97.59% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293237 | P54132 | Bloom syndrome protein |
3.5 nM 3.5 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
31622.78 nM |
AC50 |
via CMAUP
|
CHEMBL3561 | P24046 | GABA receptor rho-1 subunit |
269.15 nM 270 nM 270 nM 269.15 nM |
EC50 EC50 EC50 EC50 |
PMID: 23294161
PMID: 23294161 PMID: 25038482 PMID: 25038482 |
CHEMBL1903 | P30531 | GABA transporter 1 |
5000 nM |
IC50 |
PMID: 8057281
|
CHEMBL5208 | P48066 | GABA transporter 3 |
7000 nM |
IC50 |
PMID: 8057281
|
CHEMBL2064 | Q9UBS5 | GABA-B receptor 1 |
1700 nM |
EC50 |
PMID: 18528996
|
CHEMBL1293299 | Q03164 | Histone-lysine N-methyltransferase MLL |
79.4 nM |
Potency |
via CMAUP
|
CHEMBL5162 | Q6W5P4 | Neuropeptide S receptor |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
7.9 nM 5623.4 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1947 | P10828 | Thyroid hormone receptor beta-1 |
19952.6 nM |
Potency |
via CMAUP
|
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
31622.8 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.26% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.75% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.68% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.