Theophylline
| Internal ID | 8c5fa53d-d90f-4dd7-945e-f48a3bc4f4a9 |
| Taxonomy | Organoheterocyclic compounds > Imidazopyrimidines > Purines and purine derivatives > Xanthines |
| IUPAC Name | 1,3-dimethyl-7H-purine-2,6-dione |
| SMILES (Canonical) | CN1C2=C(C(=O)N(C1=O)C)NC=N2 |
| SMILES (Isomeric) | CN1C2=C(C(=O)N(C1=O)C)NC=N2 |
| InChI | InChI=1S/C7H8N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3H,1-2H3,(H,8,9) |
| InChI Key | ZFXYFBGIUFBOJW-UHFFFAOYSA-N |
| Popularity | 42,427 references in papers |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.06472551 g/mol |
| Topological Polar Surface Area (TPSA) | 69.30 Ų |
| XlogP | 0.00 |
| Atomic LogP (AlogP) | -1.04 |
| H-Bond Acceptor | 5 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 0 |
| 58-55-9 |
| 1,3-Dimethylxanthine |
| Elixophyllin |
| Theophylline anhydrous |
| Theophyllin |
| Theolair |
| Nuelin |
| Respbid |
| Theocin |
| Elixophylline |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9952 | 99.52% |
| Caco-2 | - | 0.7231 | 72.31% |
| Blood Brain Barrier | + | 1.0000 | 100.00% |
| Human oral bioavailability | + | 0.8429 | 84.29% |
| Subcellular localzation | Mitochondria | 0.7079 | 70.79% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.9527 | 95.27% |
| OATP1B3 inhibitior | + | 0.9524 | 95.24% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.9569 | 95.69% |
| BSEP inhibitior | - | 0.9474 | 94.74% |
| P-glycoprotein inhibitior | - | 0.9479 | 94.79% |
| P-glycoprotein substrate | - | 0.8991 | 89.91% |
| CYP3A4 substrate | - | 0.5334 | 53.34% |
| CYP2C9 substrate | - | 0.6667 | 66.67% |
| CYP2D6 substrate | - | 0.8746 | 87.46% |
| CYP3A4 inhibition | - | 0.9616 | 96.16% |
| CYP2C9 inhibition | - | 0.9933 | 99.33% |
| CYP2C19 inhibition | - | 0.9895 | 98.95% |
| CYP2D6 inhibition | - | 0.9827 | 98.27% |
| CYP1A2 inhibition | - | 0.9045 | 90.45% |
| CYP2C8 inhibition | - | 0.9882 | 98.82% |
| CYP inhibitory promiscuity | - | 0.9956 | 99.56% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.9300 | 93.00% |
| Carcinogenicity (trinary) | Non-required | 0.7077 | 70.77% |
| Eye corrosion | - | 0.9886 | 98.86% |
| Eye irritation | - | 0.9541 | 95.41% |
| Skin irritation | - | 0.8749 | 87.49% |
| Skin corrosion | - | 0.9647 | 96.47% |
| Ames mutagenesis | - | 0.8100 | 81.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4693 | 46.93% |
| Micronuclear | + | 0.9600 | 96.00% |
| Hepatotoxicity | - | 0.8500 | 85.00% |
| skin sensitisation | - | 0.9497 | 94.97% |
| Respiratory toxicity | + | 0.8222 | 82.22% |
| Reproductive toxicity | + | 0.7000 | 70.00% |
| Mitochondrial toxicity | + | 0.9000 | 90.00% |
| Nephrotoxicity | + | 0.4934 | 49.34% |
| Acute Oral Toxicity (c) | II | 0.7269 | 72.69% |
| Estrogen receptor binding | - | 0.9482 | 94.82% |
| Androgen receptor binding | - | 0.7972 | 79.72% |
| Thyroid receptor binding | - | 0.6322 | 63.22% |
| Glucocorticoid receptor binding | - | 0.8941 | 89.41% |
| Aromatase binding | - | 0.6768 | 67.68% |
| PPAR gamma | - | 0.9145 | 91.45% |
| Honey bee toxicity | - | 0.9416 | 94.16% |
| Biodegradation | + | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.5300 | 53.00% |
| Fish aquatic toxicity | - | 0.7784 | 77.84% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL226 | P30542 | Adenosine A1 receptor |
17104 nM |
IC50 |
via CMAUP
|
| CHEMBL251 | P29274 | Adenosine A2a receptor |
12007 nM |
IC50 |
via CMAUP
|
| CHEMBL255 | P29275 | Adenosine A2b receptor |
9070 nM 9070 nM 9070 nM 9070 nM 9070 nM 9070 nM 9070 nM |
Ki Ki Ki Ki Ki Ki Ki |
PMID: 16250640
PMID: 16759111 PMID: 20188574 PMID: 20537438 PMID: 24139167 PMID: 26824742 PMID: 12014951 |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
3162.3 nM 3162.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.30% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.60% | 96.09% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.83% | 93.40% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.93% | 94.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.71% | 98.59% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.71% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.98% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.20% | 94.75% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 83.12% | 94.42% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.54% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.05% | 90.00% |
| CHEMBL2424504 | P29375 | Lysine-specific demethylase 5A | 81.17% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ancistrocladus korupensis |
| Camellia ptilophylla |
| Camellia sinensis |
| Citrus limon |
| Citrus maxima |
| Coffea arabica |
| Festuca pratensis |
| Ilex paraguariensis |
| Paullinia cupana |
| Theobroma cacao |