Talbotaflavone
Internal ID | cc7b5e02-6a3c-4f6c-b980-fcc4f5ee140a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | 8-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2C(C(=O)C3=C(C=C(C=C3O2)O)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2C(C(=O)C3=C(C=C(C=C3O2)O)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)O)O |
InChI | InChI=1S/C30H20O10/c31-15-5-1-13(2-6-15)22-12-21(37)24-19(35)11-20(36)26(30(24)39-22)27-28(38)25-18(34)9-17(33)10-23(25)40-29(27)14-3-7-16(32)8-4-14/h1-12,27,29,31-36H |
InChI Key | YOGANETYFUQWIM-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H20O10 |
Molecular Weight | 540.50 g/mol |
Exact Mass | 540.10564683 g/mol |
Topological Polar Surface Area (TPSA) | 174.00 Ų |
XlogP | 4.80 |
BGH III Flavone |
Volkensiflavone |
(3,8'-Bi-4H-1-benzopyran)-4,4'-dione, 2,3-dihydro-5,5',7,7'-tetrahydroxy-2,2'-bis(4-hydroxyphenyl)- |
27542-37-6 |
[3,8'-bi-4H-1-Benzopyran]-4,4'-dione, 2,3-dihydro-5,5',7,7'-tetrahydroxy-2,2'-bis(4-hydroxyphenyl)- |
CHEMBL63919 |
SCHEMBL7620161 |
NCGC00180863-01 |
8-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-chroman-3-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
![2D Structure of Talbotaflavone 2D Structure of Talbotaflavone](https://plantaedb.com/storage/docs/compounds/2023/11/talbotaflavone.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.54% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.13% | 99.15% |
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 92.43% | 91.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.40% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.34% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.31% | 99.23% |
CHEMBL3194 | P02766 | Transthyretin | 90.78% | 90.71% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 90.21% | 98.35% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.88% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.44% | 94.45% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 88.23% | 85.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.45% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.48% | 94.73% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 84.19% | 96.00% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 83.86% | 89.23% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 83.86% | 91.38% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.41% | 93.99% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.84% | 97.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.73% | 95.78% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.95% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5315272 |
LOTUS | LTS0191877 |
wikiData | Q105351292 |