Myricetin 3-O-glucuronide
Internal ID | def46682-9fe1-47d6-a0d9-a5661a5472dd |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glucuronides > Flavonoid-3-O-glucuronides |
IUPAC Name | (2S,3S,4S,5R,6S)-6-[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)C(=O)O)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O |
InChI | InChI=1S/C21H18O14/c22-6-3-7(23)11-10(4-6)33-17(5-1-8(24)12(26)9(25)2-5)18(13(11)27)34-21-16(30)14(28)15(29)19(35-21)20(31)32/h1-4,14-16,19,21-26,28-30H,(H,31,32)/t14-,15-,16+,19-,21+/m0/s1 |
InChI Key | MBWOCQLTCWTIJE-ZUGPOPFOSA-N |
Popularity | 15 references in papers |
Molecular Formula | C21H18O14 |
Molecular Weight | 494.40 g/mol |
Exact Mass | 494.06965524 g/mol |
Topological Polar Surface Area (TPSA) | 244.00 Ų |
XlogP | 0.30 |
77363-65-6 |
Myricetin-3-O-beta-D-glucuronide |
CHEMBL458470 |
CHEBI:75807 |
(2S,3S,4S,5R,6S)-6-[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
SCHEMBL9163753 |
DTXSID00228085 |
BDBM50269642 |
myricetin 3-O-beta-D-glucoronopyranoside |
myricetin 3-O-beta-D-glucopyranosiduronic acid |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 |
10000 nM |
IC50 |
PMID: 16038536
|
CHEMBL230 | P35354 | Cyclooxygenase-2 |
8000 nM |
IC50 |
PMID: 16038536
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.53% | 91.11% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 98.18% | 95.64% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.55% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 95.98% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.25% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.73% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.27% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 90.22% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.08% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.26% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.00% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.61% | 94.00% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 85.86% | 97.53% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.46% | 99.23% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 83.19% | 94.42% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.77% | 90.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.12% | 97.36% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 81.67% | 96.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.63% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.38% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5487413 |
NPASS | NPC138927 |
ChEMBL | CHEMBL458470 |
LOTUS | LTS0016453 |
wikiData | Q27145557 |