Morolic acid
Internal ID | d65d9da1-f904-4c04-b8d7-4ebe7c226ae1 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (4aS,6aR,6aR,6bR,8aR,10S,12aR,14aS)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a-tetradecahydropicene-4a-carboxylic acid |
SMILES (Canonical) | CC1(CCC2(CCC3(C(C2=C1)CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C)C(=O)O)C |
SMILES (Isomeric) | C[C@@]12CC[C@]3(CCC(C=C3[C@H]1CC[C@H]4[C@]2(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)C)(C)C)C(=O)O |
InChI | InChI=1S/C30H48O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h18-19,21-23,31H,8-17H2,1-7H3,(H,32,33)/t19-,21+,22-,23+,27+,28-,29-,30+/m1/s1 |
InChI Key | RGZSSKBTFGNUCG-VNTGHVHSSA-N |
Popularity | 11 references in papers |
Molecular Formula | C30H48O3 |
Molecular Weight | 456.70 g/mol |
Exact Mass | 456.36034539 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 7.70 |
559-68-2 |
CHEMBL463665 |
(4aS,6aR,6aR,6bR,8aR,10S,12aR,14aS)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a-tetradecahydropicene-4a-carboxylic acid |
Olean-18-en-28-oic acid,3-hydroxy-,(3b)- |
SCHEMBL3678795 |
DTXSID001317975 |
3.beta.-Hydroxy-3-deoxymoronic acid |
BDBM50391854 |
AKOS040762070 |
(4aS,6aR,6bR,8aR,10S,12aR,12bR,14aS)-10-Hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14,14a-octadecahydro-2H-picene-4a-carboxylic acid |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4903 | P24666 | Low molecular weight phosphotyrosine protein phosphatase |
30600 nM 13400 nM |
IC50 IC50 |
PMID: 21453996
PMID: 21453996 |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B |
9100 nM |
IC50 |
PMID: 21453996
|
CHEMBL3521 | P10586 | Receptor-type tyrosine-protein phosphatase F (LAR) |
35900 nM |
IC50 |
PMID: 21453996
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.65% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.52% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.87% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.86% | 94.45% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.93% | 93.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.58% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.04% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.29% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 80.83% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 489944 |
NPASS | NPC181225 |
ChEMBL | CHEMBL463665 |
LOTUS | LTS0045784 |
wikiData | Q104402627 |