29548-30-9 |
trans,trans-Farnesyl acetate |
4128-17-0 |
All-trans-Farnesyl acetate |
(2E,6E)-Farnesyl acetate |
3,7,11-Trimethyl-2,6,10-dodecatrienyl acetate |
[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] acetate |
Farnesyl acetate, (2E,6E)- |
(E,E)-farnesyl acetate |
UNII-D5ZJ1FOC2I |
D5ZJ1FOC2I |
2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, acetate, (E,E)- |
trans2,trans6-Farnesyl acetate |
DTXSID5047110 |
(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl acetate |
trans-2-trans-6-Farnesyl acetate |
2,6,10-dodecatrien-1-ol, 3,7,11-trimethyl-, acetate, (2E,6E)- |
DTXSID2047222 |
farneoylacetate |
((2E,6E)-3,7,11-TRIMETHYLDODECA-2,6,10-TRIENYL) ACETATE |
E,E-Farnesyl Acetate |
(E)-Farnesyl acetate |
3,7,11 - trimethyldodeca - 2,6,10 - trienyl acetate |
2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, 1-acetate |
3, 7, 11- trimethyldodeca- 2, 6, 10- trienyl acetate |
Farnesyl acetate, (E,E)- |
(cis,trans)-Farnesyl acetate |
trans, trans-Farnesyl acetate |
CHEMBL3184169 |
DTXCID0027222 |
DTXCID3027110 |
farnesyl acetate, No Antioxidant |
(2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienyl acetate |
2-trans-6-trans-Farnesyl acetate |
CHEBI:186251 |
(E,E)-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol acetate |
(E,E)-3,7,11-Trimethyl-2,6,10-dodecatrien-1-yl acetate |
trans,trans-Farnesyl acetate, 95% |
Tox21_302688 |
Tox21_303761 |
LMFA07010230 |
MFCD00036516 |
NSC132958 |
s6150 |
AKOS025295075 |
AKOS037646546 |
NSC-132958 |
NCGC00256905-01 |
NCGC00356962-01 |
AS-69473 |
CAS-4128-17-0 |
CAS-29548-30-9 |
HY-128430 |
CS-0099265 |
FEMA NO. 4213, (2E,6E)- |
3,11-Trimethyl-2,6,10-dodecatrienyl acetate |
J-500791 |
2,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, acetate |
3,7,11-trimethyldodeca-2,6,10-trien-1-yl acetate |
Q27276136 |
(2E,6Z)-1-Acetoxy-3,7,11-trimethyl-2,6,10-dodecatriene |
(2Z,6Z)-3,7,11-Trimethyl-2,6,10-dodecatriene-1-ol acetate |
2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, acetate (E,E)- |
Acetic acid (6E)-3,7,11-trimethyl-2,6,10-dodecatrienyl ester |
[(E,E)-3,7,11-Trimethyl-2,6,10-dodecatriene-1-yl]ester of acetic acid |
2,6,10-DODECATRIEN-1-OL, 3,7,11-TRIMETHYL-, 1-ACETATE, (2E,6E)- |
InChI=1/C17H28O2/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-19-17(5)18/h8,10,12H,6-7,9,11,13H2,1-5H3/b15-10+,16-12 |
Y7R |
There are more than 10 synonyms. If you wish to see them all click here.
|