Epicoccolide B
Internal ID | 13072ff9-b2e9-4e91-a46b-c9e3fba4ee43 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 2-(2-formyl-3,4,5-trihydroxy-6-methylphenyl)-6,7-dihydroxy-5-methyl-1-benzofuran-4-carbaldehyde |
SMILES (Canonical) | CC1=C(C2=C(C(=C1O)O)OC(=C2)C3=C(C(=C(C(=C3C=O)O)O)O)C)C=O |
SMILES (Isomeric) | CC1=C(C2=C(C(=C1O)O)OC(=C2)C3=C(C(=C(C(=C3C=O)O)O)O)C)C=O |
InChI | InChI=1S/C18H14O8/c1-6-9(4-19)8-3-11(26-18(8)17(25)13(6)21)12-7(2)14(22)16(24)15(23)10(12)5-20/h3-5,21-25H,1-2H3 |
InChI Key | HTCVSLIHSFBUEL-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C18H14O8 |
Molecular Weight | 358.30 g/mol |
Exact Mass | 358.06886740 g/mol |
Topological Polar Surface Area (TPSA) | 148.00 Ų |
XlogP | 2.40 |
Atomic LogP (AlogP) | 2.87 |
H-Bond Acceptor | 8 |
H-Bond Donor | 5 |
Rotatable Bonds | 3 |
CHEMBL3104855 |
Epicoccolide B_130095 |
SCHEMBL14563907 |
BDBM50445474 |
2-(2-formyl-3,4,5-trihydroxy-6-methyl-phenyl)-6,7-dihydroxy-5-methyl-benzofuran-4-carbaldehyde |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9520 | 95.20% |
Caco-2 | - | 0.5194 | 51.94% |
Blood Brain Barrier | - | 0.6000 | 60.00% |
Human oral bioavailability | - | 0.6571 | 65.71% |
Subcellular localzation | Mitochondria | 0.7362 | 73.62% |
OATP2B1 inhibitior | + | 0.5882 | 58.82% |
OATP1B1 inhibitior | - | 0.3638 | 36.38% |
OATP1B3 inhibitior | + | 0.9047 | 90.47% |
MATE1 inhibitior | - | 0.5800 | 58.00% |
OCT2 inhibitior | - | 0.9250 | 92.50% |
BSEP inhibitior | - | 0.6280 | 62.80% |
P-glycoprotein inhibitior | - | 0.8657 | 86.57% |
P-glycoprotein substrate | - | 0.8194 | 81.94% |
CYP3A4 substrate | - | 0.5089 | 50.89% |
CYP2C9 substrate | - | 0.6433 | 64.33% |
CYP2D6 substrate | - | 0.8552 | 85.52% |
CYP3A4 inhibition | - | 0.6876 | 68.76% |
CYP2C9 inhibition | + | 0.6310 | 63.10% |
CYP2C19 inhibition | - | 0.7938 | 79.38% |
CYP2D6 inhibition | - | 0.9047 | 90.47% |
CYP1A2 inhibition | + | 0.8712 | 87.12% |
CYP2C8 inhibition | - | 0.6391 | 63.91% |
CYP inhibitory promiscuity | + | 0.6124 | 61.24% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9543 | 95.43% |
Carcinogenicity (trinary) | Non-required | 0.5285 | 52.85% |
Eye corrosion | - | 0.9913 | 99.13% |
Eye irritation | - | 0.5846 | 58.46% |
Skin irritation | - | 0.6410 | 64.10% |
Skin corrosion | - | 0.8817 | 88.17% |
Ames mutagenesis | - | 0.5400 | 54.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4246 | 42.46% |
Micronuclear | + | 0.8900 | 89.00% |
Hepatotoxicity | + | 0.5625 | 56.25% |
skin sensitisation | - | 0.8065 | 80.65% |
Respiratory toxicity | - | 0.6333 | 63.33% |
Reproductive toxicity | + | 0.6444 | 64.44% |
Mitochondrial toxicity | + | 0.6125 | 61.25% |
Nephrotoxicity | - | 0.6673 | 66.73% |
Acute Oral Toxicity (c) | III | 0.6072 | 60.72% |
Estrogen receptor binding | + | 0.8738 | 87.38% |
Androgen receptor binding | + | 0.7510 | 75.10% |
Thyroid receptor binding | - | 0.5800 | 58.00% |
Glucocorticoid receptor binding | + | 0.7408 | 74.08% |
Aromatase binding | + | 0.5617 | 56.17% |
PPAR gamma | + | 0.7433 | 74.33% |
Honey bee toxicity | - | 0.8661 | 86.61% |
Biodegradation | - | 0.9750 | 97.50% |
Crustacea aquatic toxicity | - | 0.6500 | 65.00% |
Fish aquatic toxicity | + | 0.9818 | 98.18% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor |
250 nM 250 nM |
IC50 IC50 |
via Super-PRED
PMID: 24328302 |
CHEMBL2695 | Q05397 | Focal adhesion kinase 1 |
800 nM 800 nM |
IC50 IC50 |
via Super-PRED
PMID: 24328302 |
CHEMBL3717 | P08581 | Hepatocyte growth factor receptor |
1120 nM |
IC50 |
PMID: 24328302
|
CHEMBL325 | Q13547 | Histone deacetylase 1 |
8800 nM |
IC50 |
PMID: 24328302
|
CHEMBL5103 | Q969S8 | Histone deacetylase 10 |
8100 nM |
IC50 |
PMID: 24328302
|
CHEMBL1937 | Q92769 | Histone deacetylase 2 |
9100 nM |
IC50 |
PMID: 24328302
|
CHEMBL1829 | O15379 | Histone deacetylase 3 |
6900 nM |
IC50 |
PMID: 24328302
|
CHEMBL1865 | Q9UBN7 | Histone deacetylase 6 |
6500 nM |
IC50 |
PMID: 24328302
|
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 |
2100 nM |
IC50 |
PMID: 24328302
|
CHEMBL1957 | P08069 | Insulin-like growth factor I receptor |
150 nM 150 nM |
IC50 IC50 |
PMID: 24328302
via Super-PRED |
CHEMBL5784 | O60285 | NUAK family SNF1-like kinase 1 |
3770 nM |
IC50 |
PMID: 24328302
|
CHEMBL3384 | Q16512 | Protein kinase N1 |
9000 nM |
IC50 |
PMID: 24328302
|
CHEMBL4282 | P31749 | Serine/threonine-protein kinase AKT |
4070 nM |
IC50 |
PMID: 24328302
|
CHEMBL2185 | Q96GD4 | Serine/threonine-protein kinase Aurora-B |
7290 nM |
IC50 |
PMID: 24328302
|
CHEMBL3835 | P51955 | Serine/threonine-protein kinase NEK2 |
3780 nM |
IC50 |
PMID: 24328302
|
CHEMBL4309 | Q9HC98 | Serine/threonine-protein kinase NEK6 |
1850 nM |
IC50 |
PMID: 24328302
|
CHEMBL2147 | P11309 | Serine/threonine-protein kinase PIM1 |
4440 nM |
IC50 |
PMID: 24328302
|
CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 |
6310 nM |
IC50 |
PMID: 24328302
|
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO |
220 nM 220 nM |
IC50 IC50 |
PMID: 24328302
via Super-PRED |
CHEMBL267 | P12931 | Tyrosine-protein kinase SRC |
490 nM 490 nM |
IC50 IC50 |
via Super-PRED
PMID: 24328302 |
CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 |
390 nM 390 nM |
IC50 IC50 |
via Super-PRED
PMID: 24328302 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 98.32% | 98.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.38% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.27% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.21% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.02% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.44% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 90.53% | 98.95% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.91% | 93.65% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.10% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 11210533 |
NPASS | NPC277510 |
ChEMBL | CHEMBL3104855 |
LOTUS | LTS0252556 |
wikiData | Q77281364 |