(E)-5-(4-Methoxystyryl)benzene-1,3-diol
Internal ID | 9bde558e-168b-42f9-8318-3e5f3c8a91e5 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene-1,3-diol |
SMILES (Canonical) | COC1=CC=C(C=C1)C=CC2=CC(=CC(=C2)O)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)/C=C/C2=CC(=CC(=C2)O)O |
InChI | InChI=1S/C15H14O3/c1-18-15-6-4-11(5-7-15)2-3-12-8-13(16)10-14(17)9-12/h2-10,16-17H,1H3/b3-2+ |
InChI Key | IHVRWFJGOIWMGC-NSCUHMNNSA-N |
Popularity | 42 references in papers |
Molecular Formula | C15H14O3 |
Molecular Weight | 242.27 g/mol |
Exact Mass | 242.094294304 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 3.50 |
Atomic LogP (AlogP) | 3.28 |
H-Bond Acceptor | 3 |
H-Bond Donor | 2 |
Rotatable Bonds | 3 |
(E)-5-(4-Methoxystyryl)benzene-1,3-diol |
4'-Methoxyresveratrol |
RESVERATROL 4'-METHYL ETHER |
Desoxyrhapontigenin |
Deoxyrhapontigenin |
4-Methoxyresveratrol |
3,5-Dihydroxy-4'-methoxystilbene |
RU7RRY3RUW |
CHEMBL291501 |
BML 233 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9888 | 98.88% |
Caco-2 | + | 0.8688 | 86.88% |
Blood Brain Barrier | - | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.6143 | 61.43% |
Subcellular localzation | Mitochondria | 0.7441 | 74.41% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9489 | 94.89% |
OATP1B3 inhibitior | + | 0.9749 | 97.49% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.8838 | 88.38% |
BSEP inhibitior | - | 0.5572 | 55.72% |
P-glycoprotein inhibitior | - | 0.9055 | 90.55% |
P-glycoprotein substrate | - | 0.9826 | 98.26% |
CYP3A4 substrate | - | 0.6515 | 65.15% |
CYP2C9 substrate | - | 0.5963 | 59.63% |
CYP2D6 substrate | - | 0.6581 | 65.81% |
CYP3A4 inhibition | + | 0.5761 | 57.61% |
CYP2C9 inhibition | + | 0.7138 | 71.38% |
CYP2C19 inhibition | + | 0.8614 | 86.14% |
CYP2D6 inhibition | - | 0.9055 | 90.55% |
CYP1A2 inhibition | + | 0.9338 | 93.38% |
CYP2C8 inhibition | - | 0.6524 | 65.24% |
CYP inhibitory promiscuity | + | 0.8533 | 85.33% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.6739 | 67.39% |
Carcinogenicity (trinary) | Non-required | 0.5484 | 54.84% |
Eye corrosion | - | 0.9699 | 96.99% |
Eye irritation | + | 0.9716 | 97.16% |
Skin irritation | - | 0.6370 | 63.70% |
Skin corrosion | - | 0.7135 | 71.35% |
Ames mutagenesis | - | 0.7800 | 78.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5947 | 59.47% |
Micronuclear | - | 0.5700 | 57.00% |
Hepatotoxicity | - | 0.7267 | 72.67% |
skin sensitisation | - | 0.5559 | 55.59% |
Respiratory toxicity | - | 0.8000 | 80.00% |
Reproductive toxicity | - | 0.5667 | 56.67% |
Mitochondrial toxicity | - | 0.7750 | 77.50% |
Nephrotoxicity | + | 0.4771 | 47.71% |
Acute Oral Toxicity (c) | III | 0.6259 | 62.59% |
Estrogen receptor binding | + | 0.8785 | 87.85% |
Androgen receptor binding | + | 0.7056 | 70.56% |
Thyroid receptor binding | + | 0.7059 | 70.59% |
Glucocorticoid receptor binding | + | 0.6209 | 62.09% |
Aromatase binding | + | 0.8888 | 88.88% |
PPAR gamma | + | 0.8077 | 80.77% |
Honey bee toxicity | - | 0.9553 | 95.53% |
Biodegradation | - | 0.9500 | 95.00% |
Crustacea aquatic toxicity | + | 0.6600 | 66.00% |
Fish aquatic toxicity | + | 0.9231 | 92.31% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3687 | P18054 | Arachidonate 12-lipoxygenase |
19952.6 nM |
Potency |
via CMAUP
|
CHEMBL221 | P23219 | Cyclooxygenase-1 |
25800 nM |
IC50 |
PMID: 18487053
|
CHEMBL230 | P35354 | Cyclooxygenase-2 |
19600 nM |
IC50 |
PMID: 18487053
|
CHEMBL2231 | P04798 | Cytochrome P450 1A1 |
160 nM |
Ki |
DOI: 10.1039/C0MD00242A
|
CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
800 nM 800 nM |
IC50 IC50 |
DOI: 10.1039/C3MD00317E
via Super-PRED |
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
22387.2 nM |
Potency |
via CMAUP
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
11220.2 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.78% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.80% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.39% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.59% | 90.00% |
CHEMBL3194 | P02766 | Transthyretin | 89.75% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.49% | 86.33% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 89.08% | 96.12% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.56% | 96.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.64% | 93.99% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.27% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.20% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.29% | 99.15% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.72% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.29% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dracaena cochinchinensis |
Knema austrosiamensis |
Rheum australe |
Rheum officinale |
Rheum palmatum |
Rheum rhabarbarum |
Rheum tanguticum |
Rumex bucephalophorus |
PubChem | 6255462 |
NPASS | NPC296920 |
ChEMBL | CHEMBL291501 |
LOTUS | LTS0110115 |
wikiData | Q17299987 |