9-Hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carbaldehyde
Internal ID | 8a638923-f3b6-47d7-80f1-689c05107005 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carbaldehyde |
SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)O)C)C=O |
SMILES (Isomeric) | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)O)C)C=O |
InChI | InChI=1S/C30H48O2/c1-19(2)20-10-15-30(18-31)17-16-28(6)21(25(20)30)8-9-23-27(5)13-12-24(32)26(3,4)22(27)11-14-29(23,28)7/h18,20-25,32H,1,8-17H2,2-7H3 |
InChI Key | FELCJAPFJOPHSD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O2 |
Molecular Weight | 440.70 g/mol |
Exact Mass | 440.365430770 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 8.10 |
9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carbaldehyde |
SCHEMBL3959468 |
FELCJAPFJOPHSD-UHFFFAOYSA-N |
BCP12885 |
Betulinic aldehyde; Betunal;Betulinal |
AKOS032947792 |
NSC-250423 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.36% | 96.61% |
CHEMBL233 | P35372 | Mu opioid receptor | 91.35% | 97.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.39% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.55% | 100.00% |
CHEMBL240 | Q12809 | HERG | 89.54% | 89.76% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.84% | 94.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.01% | 94.45% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 87.02% | 92.97% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.38% | 82.69% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.20% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 86.16% | 98.95% |
CHEMBL204 | P00734 | Thrombin | 84.11% | 96.01% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.82% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.17% | 91.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.83% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.63% | 91.49% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.31% | 96.77% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.68% | 92.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 317607 |
NPASS | NPC116876 |
LOTUS | LTS0046970 |
wikiData | Q104667345 |