Cucurbitacin D
Internal ID | c55db9ff-f4cf-4517-bd6f-12e44bddbf7d |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | (2S,8S,9R,10R,13R,14S,16R,17R)-17-[(E,2R)-2,6-dihydroxy-6-methyl-3-oxohept-4-en-2-yl]-2,16-dihydroxy-4,4,9,13,14-pentamethyl-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione |
SMILES (Canonical) | CC1(C2=CCC3C4(CC(C(C4(CC(=O)C3(C2CC(C1=O)O)C)C)C(C)(C(=O)C=CC(C)(C)O)O)O)C)C |
SMILES (Isomeric) | C[C@@]12C[C@H]([C@@H]([C@]1(CC(=O)[C@@]3([C@H]2CC=C4[C@H]3C[C@@H](C(=O)C4(C)C)O)C)C)[C@](C)(C(=O)/C=C/C(C)(C)O)O)O |
InChI | InChI=1S/C30H44O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,11-12,17-20,23,31-32,36-37H,10,13-15H2,1-8H3/b12-11+/t17-,18+,19-,20+,23+,27+,28-,29+,30+/m1/s1 |
InChI Key | SRPHMISUTWFFKJ-QJNWWGCFSA-N |
Popularity | 70 references in papers |
Molecular Formula | C30H44O7 |
Molecular Weight | 516.70 g/mol |
Exact Mass | 516.30870374 g/mol |
Topological Polar Surface Area (TPSA) | 132.00 Ų |
XlogP | 2.10 |
Elatericin A |
3877-86-9 |
Elatericine A |
Cucurbitacine (D) |
NSC 308606 |
NSC 521776 |
UNII-5I62H4ORC7 |
5I62H4ORC7 |
CHEBI:3943 |
NSC308606 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1803 | P20701 | Leukocyte adhesion glycoprotein LFA-1 alpha |
1360 nM |
IC50 |
PMID: 7852999
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.85% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.43% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.94% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 90.78% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.57% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.40% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.17% | 96.09% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 88.12% | 87.67% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.15% | 85.14% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.91% | 97.05% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.41% | 90.17% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.37% | 89.34% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.03% | 91.19% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.72% | 90.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.70% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.54% | 96.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.45% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.00% | 89.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.34% | 91.07% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.30% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5281318 |
NPASS | NPC311612 |
ChEMBL | CHEMBL493646 |
LOTUS | LTS0059270 |
wikiData | Q15410915 |