Corytuberine
| Internal ID | 75370873-b06a-4365-94ee-0afc3596704b |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | (6aS)-2,10-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,11-diol |
| SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)O)OC |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)O)OC |
| InChI | InChI=1S/C19H21NO4/c1-20-7-6-11-9-14(24-3)19(22)17-15(11)12(20)8-10-4-5-13(23-2)18(21)16(10)17/h4-5,9,12,21-22H,6-8H2,1-3H3/t12-/m0/s1 |
| InChI Key | WHFUDAOCYRYAKQ-LBPRGKRZSA-N |
| Popularity | 14 references in papers |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 62.20 Ų |
| XlogP | 2.20 |
| 517-56-6 |
| (S)-corytuberine |
| (+)-CORYTUBERINE |
| UNII-4YJ94A3D8W |
| (6aS)-2,10-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,11-diol |
| 4YJ94A3D8W |
| CHEMBL227965 |
| CHEBI:81200 |
| (6aS)-5,6,6a,7-Tetrahydro-2,10-dimethoxy-6-methyl-4H-dibenzo[de,g]quinoline-1,11-diol |
| (6AS)-5,6,6A,7-TETRAHYDRO-2,10-DIMETHOXY-6-METHYL-4H-DIBENZO(DE,G)QUINOLINE-1,11-DIOL |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.12% | 96.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 97.18% | 95.62% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.43% | 91.49% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.62% | 91.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.27% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.03% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.17% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.57% | 98.95% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.55% | 89.62% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 89.47% | 91.79% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.26% | 90.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.50% | 85.14% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.28% | 88.48% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.77% | 93.40% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.67% | 86.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.58% | 92.94% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.83% | 91.03% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.60% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.28% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.09% | 93.99% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.08% | 95.78% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.19% | 82.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 160500 |
| NPASS | NPC158376 |
| ChEMBL | CHEMBL227965 |
| LOTUS | LTS0022981 |
| wikiData | Q27155145 |