CID 11766372
Internal ID | 036b7527-1902-429d-b2c2-4628d4636763 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(10R,11S,12R,15R)-3,4,5,21,22,23-hexahydroxy-8,18-dioxo-12,13-bis[(3,4,5-trihydroxybenzoyl)oxy]-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-11-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)O1)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@@H]([C@H](C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)O1)O)O)O)O)O)O |
InChI | InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)65-34-33-23(9-62-39(60)13-7-21(48)29(53)31(55)24(13)25-14(40(61)64-33)8-22(49)30(54)32(25)56)63-41(67-38(59)12-5-19(46)28(52)20(47)6-12)35(34)66-37(58)11-3-17(44)27(51)18(45)4-11/h1-8,23,33-35,41-56H,9H2/t23-,33-,34+,35-,41?/m1/s1 |
InChI Key | JCGHAEBIBSEQAD-WZASNERQSA-N |
Popularity | 12 references in papers |
Molecular Formula | C41H30O26 |
Molecular Weight | 938.70 g/mol |
Exact Mass | 938.10253106 g/mol |
Topological Polar Surface Area (TPSA) | 444.00 Ų |
XlogP | 2.40 |
D0E6SO |
BDBM50269544 |
[(10R,11S,12R,15R)-3,4,5,21,22,23-hexahydroxy-8,18-dioxo-12,13-bis[(3,4,5-trihydroxybenzoyl)oxy]-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-11-yl] 3,4,5-trihydroxybenzoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL244 | P00742 | Coagulation factor X |
210 nM 210 nM |
IC50 IC50 |
via Super-PRED
PMID: 9834152 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.88% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.64% | 91.49% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 94.47% | 83.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.67% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.51% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.24% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.99% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 86.19% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.71% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.70% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.63% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.17% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 84.07% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.98% | 95.89% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.37% | 96.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.82% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.33% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.63% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.19% | 92.62% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.99% | 92.50% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.47% | 95.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 11766372 |
NPASS | NPC261411 |
ChEMBL | CHEMBL510512 |
LOTUS | LTS0271450 |
wikiData | Q104390902 |