Breviscapine
Internal ID | 5b20dffb-5cb5-49e1-a613-65d4d34b91ea |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glucuronides > Flavonoid-7-O-glucuronides |
IUPAC Name | 6-[5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | C1=CC(=CC=C1C2=CC(=O)C3=C(C(=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=CC(=O)C3=C(C(=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)O)O)O)O |
InChI | InChI=1S/C21H18O12/c22-8-3-1-7(2-4-8)10-5-9(23)13-11(31-10)6-12(14(24)15(13)25)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-22,24-28H,(H,29,30) |
InChI Key | DJSISFGPUUYILV-UHFFFAOYSA-N |
Popularity | 133 references in papers |
Molecular Formula | C21H18O12 |
Molecular Weight | 462.40 g/mol |
Exact Mass | 462.07982601 g/mol |
Topological Polar Surface Area (TPSA) | 203.00 Ų |
XlogP | 0.80 |
116122-36-2 |
6-[5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
Scutellarein 7-glucuronide |
SCHEMBL16519697 |
FT-0630536 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.24% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.37% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.98% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 95.53% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 94.25% | 95.64% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.21% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.05% | 86.33% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 90.98% | 95.78% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.41% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.39% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.26% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.72% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.63% | 90.71% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 86.64% | 83.57% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.50% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.35% | 95.56% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.15% | 91.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.42% | 95.89% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 82.78% | 89.23% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.23% | 99.15% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.18% | 96.21% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.53% | 95.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.71% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 6426802 |
LOTUS | LTS0192632 |
wikiData | Q104667679 |