Androstenedione
Internal ID | 8f5c26b4-d6ef-4e2d-91d8-d5aa789eabd3 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Androstane steroids > Androgens and derivatives |
IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
SMILES (Canonical) | CC12CCC(=O)C=C1CCC3C2CCC4(C3CCC4=O)C |
SMILES (Isomeric) | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C |
InChI | InChI=1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-16H,3-10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
InChI Key | AEMFNILZOJDQLW-QAGGRKNESA-N |
Popularity | 16,420 references in papers |
Molecular Formula | C19H26O2 |
Molecular Weight | 286.40 g/mol |
Exact Mass | 286.193280068 g/mol |
Topological Polar Surface Area (TPSA) | 34.10 Ų |
XlogP | 2.70 |
Atomic LogP (AlogP) | 4.09 |
H-Bond Acceptor | 2 |
H-Bond Donor | 0 |
Rotatable Bonds | 0 |
4-Androstene-3,17-dione |
Androst-4-ene-3,17-dione |
63-05-8 |
4-Androstenedione |
Androtex |
3,17-Dioxoandrost-4-ene |
delta-4-Androstenedione |
SKF 2170 |
Androstendione |
Fecundin |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 1.0000 | 100.00% |
Caco-2 | + | 0.9146 | 91.46% |
Blood Brain Barrier | + | 0.8580 | 85.80% |
Human oral bioavailability | - | 0.6000 | 60.00% |
Subcellular localzation | Mitochondria | 0.6953 | 69.53% |
OATP2B1 inhibitior | - | 0.8779 | 87.79% |
OATP1B1 inhibitior | + | 0.9473 | 94.73% |
OATP1B3 inhibitior | + | 0.9828 | 98.28% |
MATE1 inhibitior | - | 0.8800 | 88.00% |
OCT2 inhibitior | + | 0.7750 | 77.50% |
BSEP inhibitior | + | 0.5515 | 55.15% |
P-glycoprotein inhibitior | + | 0.8945 | 89.45% |
P-glycoprotein substrate | - | 0.9362 | 93.62% |
CYP3A4 substrate | + | 0.6211 | 62.11% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8716 | 87.16% |
CYP3A4 inhibition | - | 0.8483 | 84.83% |
CYP2C9 inhibition | - | 0.9387 | 93.87% |
CYP2C19 inhibition | - | 0.8138 | 81.38% |
CYP2D6 inhibition | - | 0.9386 | 93.86% |
CYP1A2 inhibition | - | 0.9046 | 90.46% |
CYP2C8 inhibition | - | 0.8375 | 83.75% |
CYP inhibitory promiscuity | - | 0.8067 | 80.67% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Warning | 0.4588 | 45.88% |
Eye corrosion | - | 0.9906 | 99.06% |
Eye irritation | - | 0.9349 | 93.49% |
Skin irritation | + | 0.5678 | 56.78% |
Skin corrosion | - | 0.9606 | 96.06% |
Ames mutagenesis | - | 0.9700 | 97.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4934 | 49.34% |
Micronuclear | - | 0.8400 | 84.00% |
Hepatotoxicity | + | 0.9500 | 95.00% |
skin sensitisation | + | 0.6861 | 68.61% |
Respiratory toxicity | + | 0.9333 | 93.33% |
Reproductive toxicity | + | 1.0000 | 100.00% |
Mitochondrial toxicity | + | 0.9375 | 93.75% |
Nephrotoxicity | - | 0.7721 | 77.21% |
Acute Oral Toxicity (c) | III | 0.7373 | 73.73% |
Estrogen receptor binding | + | 0.9091 | 90.91% |
Androgen receptor binding | + | 0.8900 | 89.00% |
Thyroid receptor binding | + | 0.8114 | 81.14% |
Glucocorticoid receptor binding | + | 0.8397 | 83.97% |
Aromatase binding | + | 0.6368 | 63.68% |
PPAR gamma | - | 0.5597 | 55.97% |
Honey bee toxicity | - | 0.8267 | 82.67% |
Biodegradation | - | 0.7750 | 77.50% |
Crustacea aquatic toxicity | + | 0.6600 | 66.00% |
Fish aquatic toxicity | + | 0.9913 | 99.13% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
12.6 nM 12.6 nM |
Potency Potency |
via CMAUP
via Super-PRED |
CHEMBL2421 | P08185 | Corticosteroid binding globulin |
1737.8 nM |
Ki |
PMID: 15139751
|
CHEMBL1978 | P11511 | Cytochrome P450 19A1 |
300 nM 20 nM |
IC50 Ki |
PMID: 8035427
via Super-PRED |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL4234 | P37058 | Estradiol 17-beta-dehydrogenase 3 |
758 nM 758 nM 758 nM 758 nM |
IC50 IC50 IC50 IC50 |
PMID: 11086723
via Super-PRED PMID: 16078844 PMID: 11806715 |
CHEMBL4040 | P28482 | MAP kinase ERK2 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL5162 | Q6W5P4 | Neuropeptide S receptor |
251.2 nM 251.2 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL1293235 | P02545 | Prelamin-A/C |
10000 nM |
Potency |
via CMAUP
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
6.3 nM 3162.3 nM 6.3 nM |
Potency Potency Potency |
via Super-PRED
via CMAUP via CMAUP |
CHEMBL3305 | P04278 | Testis-specific androgen-binding protein |
34.67 nM |
Kd |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 95.85% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.82% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.35% | 96.09% |
CHEMBL1871 | P10275 | Androgen Receptor | 94.32% | 96.43% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 91.39% | 85.30% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.00% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.12% | 95.56% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 86.97% | 94.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.53% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.07% | 90.17% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.30% | 94.75% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.87% | 93.04% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.71% | 93.40% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.50% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 6128 |
NPASS | NPC139397 |
ChEMBL | CHEMBL274826 |
LOTUS | LTS0036728 |
wikiData | Q411064 |