4-[(3S,3aR,6aR)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenol
Internal ID | fa000ba3-c8c9-4832-84e0-bdfad32da5f7 |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
IUPAC Name | 4-[(3S,3aR,6aR)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2C3COC(C3CO2)C4=CC(=C(C=C4)O)OC |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C=C4)O)OC |
InChI | InChI=1S/C21H24O7/c1-24-16-6-11(4-5-15(16)22)20-13-9-28-21(14(13)10-27-20)12-7-17(25-2)19(23)18(8-12)26-3/h4-8,13-14,20-23H,9-10H2,1-3H3/t13-,14-,20+,21?/m0/s1 |
InChI Key | VJOBNGRIBLNUKN-ITZZLVQVSA-N |
Popularity | 16 references in papers |
Molecular Formula | C21H24O7 |
Molecular Weight | 388.40 g/mol |
Exact Mass | 388.15220310 g/mol |
Topological Polar Surface Area (TPSA) | 86.60 Ų |
XlogP | 2.30 |
CHEMBL513023 |
4-[(3S,3aR,6aR)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenol |
(-) Medioresinol |
D00RGP |
BDBM50259877 |
NSC329245 |
NSC-329245 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
13700 nM |
IC50 |
PMID: 15679319
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.29% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.52% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.49% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.29% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.32% | 89.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.89% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.26% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.22% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.01% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.77% | 92.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.46% | 99.15% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 84.35% | 88.48% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.52% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.94% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 81.93% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.04% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.15% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 332425 |
NPASS | NPC99572 |
ChEMBL | CHEMBL513023 |
LOTUS | LTS0041035 |
wikiData | Q104401593 |