7-O-Methylluteolin
Internal ID | f72c8719-30c9-48b0-b783-0bcef86650a9 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxychromen-4-one |
SMILES (Canonical) | COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC(=C(C=C3)O)O)O |
SMILES (Isomeric) | COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC(=C(C=C3)O)O)O |
InChI | InChI=1S/C16H12O6/c1-21-9-5-12(19)16-13(20)7-14(22-15(16)6-9)8-2-3-10(17)11(18)4-8/h2-7,17-19H,1H3 |
InChI Key | RRRSSAVLTCVNIQ-UHFFFAOYSA-N |
Popularity | 37 references in papers |
Molecular Formula | C16H12O6 |
Molecular Weight | 300.26 g/mol |
Exact Mass | 300.06338810 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 1.70 |
20243-59-8 |
7-O-Methylluteolin |
Luteolin 7-methyl ether |
2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-4H-chromen-4-one |
2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxychromen-4-one |
4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy- |
3'-hydroxygenkwanin |
5,3',4'-Trihydroxy-7-methoxyflavone |
CHEMBL183745 |
UNII-732GA1Z079 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1801 | P00747 | Plasminogen |
2300 nM |
IC50 |
PMID: 15787457
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.98% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.49% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 97.38% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.51% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.69% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.26% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.35% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 89.56% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.46% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.62% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.59% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.57% | 94.73% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.29% | 93.31% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.08% | 93.65% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.64% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.01% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.28% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5318214 |
NPASS | NPC108406 |
ChEMBL | CHEMBL183745 |
LOTUS | LTS0259993 |
wikiData | Q27266123 |