(5E)-1-Phenyl-5-heptene-1,3-diyn-7-ol acetate
Internal ID | f57a12e8-3417-4c2d-8cd0-d9ed66f9d090 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohol esters |
IUPAC Name | [(E)-7-phenylhept-2-en-4,6-diynyl] acetate |
SMILES (Canonical) | CC(=O)OCC=CC#CC#CC1=CC=CC=C1 |
SMILES (Isomeric) | CC(=O)OC/C=C/C#CC#CC1=CC=CC=C1 |
InChI | InChI=1S/C15H12O2/c1-14(16)17-13-9-4-2-3-6-10-15-11-7-5-8-12-15/h4-5,7-9,11-12H,13H2,1H3/b9-4+ |
InChI Key | JEAKICNMCJBNSA-RUDMXATFSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H12O2 |
Molecular Weight | 224.25 g/mol |
Exact Mass | 224.083729621 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 3.00 |
(2e)-7-phenylhepta-2-en-4,6-diyn-1-yl acetate |
(5E)-1-Phenyl-5-heptene-1,3-diyn-7-ol acetate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.41% | 96.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.45% | 94.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.25% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.38% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.32% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.96% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.88% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.32% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.08% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.37% | 90.17% |
CHEMBL5028 | O14672 | ADAM10 | 81.72% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 23274467 |
NPASS | NPC133237 |
LOTUS | LTS0034524 |
wikiData | Q105132509 |