3,4-Dimethoxycinnamic acid
Internal ID | 8a86d5ec-d858-4ff2-b691-064688dbf229 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
SMILES (Canonical) | COC1=C(C=C(C=C1)C=CC(=O)O)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)/C=C/C(=O)O)OC |
InChI | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/b6-4+ |
InChI Key | HJBWJAPEBGSQPR-GQCTYLIASA-N |
Popularity | 195 references in papers |
Molecular Formula | C11H12O4 |
Molecular Weight | 208.21 g/mol |
Exact Mass | 208.07355886 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 1.80 |
Atomic LogP (AlogP) | 1.80 |
H-Bond Acceptor | 3 |
H-Bond Donor | 1 |
Rotatable Bonds | 4 |
2316-26-9 |
14737-89-4 |
Dimethylcaffeic acid |
(E)-3-(3,4-dimethoxyphenyl)acrylic acid |
Caffeic acid dimethyl ether |
(E)-3,4-dimethoxycinnamic acid |
o-Methylferulic acid |
3,4-Dimethoxycinnamic acid, predominantly trans |
(2E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
Dimethyl caffeic acid |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9885 | 98.85% |
Caco-2 | + | 0.8672 | 86.72% |
Blood Brain Barrier | - | 0.5250 | 52.50% |
Human oral bioavailability | + | 0.8429 | 84.29% |
Subcellular localzation | Mitochondria | 0.8623 | 86.23% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9550 | 95.50% |
OATP1B3 inhibitior | + | 0.9798 | 97.98% |
MATE1 inhibitior | - | 0.9800 | 98.00% |
OCT2 inhibitior | - | 0.9750 | 97.50% |
BSEP inhibitior | - | 0.7411 | 74.11% |
P-glycoprotein inhibitior | - | 0.9827 | 98.27% |
P-glycoprotein substrate | - | 0.9502 | 95.02% |
CYP3A4 substrate | - | 0.6619 | 66.19% |
CYP2C9 substrate | - | 0.7953 | 79.53% |
CYP2D6 substrate | - | 0.8567 | 85.67% |
CYP3A4 inhibition | - | 0.8604 | 86.04% |
CYP2C9 inhibition | - | 0.9282 | 92.82% |
CYP2C19 inhibition | - | 0.8081 | 80.81% |
CYP2D6 inhibition | - | 0.9417 | 94.17% |
CYP1A2 inhibition | - | 0.8629 | 86.29% |
CYP2C8 inhibition | + | 0.5267 | 52.67% |
CYP inhibitory promiscuity | - | 0.8081 | 80.81% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.7197 | 71.97% |
Carcinogenicity (trinary) | Non-required | 0.6339 | 63.39% |
Eye corrosion | + | 0.4560 | 45.60% |
Eye irritation | + | 0.9716 | 97.16% |
Skin irritation | + | 0.7105 | 71.05% |
Skin corrosion | - | 0.9614 | 96.14% |
Ames mutagenesis | - | 0.9600 | 96.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.6263 | 62.63% |
Micronuclear | + | 0.5507 | 55.07% |
Hepatotoxicity | - | 0.6625 | 66.25% |
skin sensitisation | - | 0.8309 | 83.09% |
Respiratory toxicity | - | 0.9111 | 91.11% |
Reproductive toxicity | + | 0.7667 | 76.67% |
Mitochondrial toxicity | - | 0.9000 | 90.00% |
Nephrotoxicity | - | 0.7461 | 74.61% |
Acute Oral Toxicity (c) | III | 0.6244 | 62.44% |
Estrogen receptor binding | + | 0.5624 | 56.24% |
Androgen receptor binding | + | 0.6652 | 66.52% |
Thyroid receptor binding | - | 0.7050 | 70.50% |
Glucocorticoid receptor binding | - | 0.7530 | 75.30% |
Aromatase binding | - | 0.6244 | 62.44% |
PPAR gamma | - | 0.7912 | 79.12% |
Honey bee toxicity | - | 0.9562 | 95.62% |
Biodegradation | + | 0.5250 | 52.50% |
Crustacea aquatic toxicity | - | 0.6207 | 62.07% |
Fish aquatic toxicity | + | 0.9647 | 96.47% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
22387.2 nM 19952.6 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
22387.2 nM |
Potency |
via CMAUP
|
CHEMBL2903 | P16050 | Arachidonate 15-lipoxygenase |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
39810.7 nM 35481.3 nM 28183.8 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP |
CHEMBL4040 | P28482 | MAP kinase ERK2 |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
446.7 nM 446.7 nM |
Potency Potency |
via Super-PRED
via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.34% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.07% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.42% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.20% | 95.56% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 86.68% | 90.20% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.11% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 85.74% | 90.71% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.61% | 95.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.96% | 91.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.76% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.51% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.76% | 89.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.74% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 717531 |
NPASS | NPC294941 |
ChEMBL | CHEMBL320295 |
LOTUS | LTS0059066 |
wikiData | Q15410159 |