1,2,4,6-Tetragalloyl-beta-D-glucopyranose
Internal ID | 0326cc47-01cd-451b-a870-7bc5ab2dd071 |
Taxonomy | Phenylpropanoids and polyketides > Tannins |
IUPAC Name | [4-hydroxy-3,5,6-tris[(3,4,5-trihydroxybenzoyl)oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O |
InChI | InChI=1S/C34H28O22/c35-14-1-10(2-15(36)23(14)43)30(48)52-9-22-28(54-31(49)11-3-16(37)24(44)17(38)4-11)27(47)29(55-32(50)12-5-18(39)25(45)19(40)6-12)34(53-22)56-33(51)13-7-20(41)26(46)21(42)8-13/h1-8,22,27-29,34-47H,9H2 |
InChI Key | YXZYFHXWEOAXLF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H28O22 |
Molecular Weight | 788.60 g/mol |
Exact Mass | 788.10722252 g/mol |
Topological Polar Surface Area (TPSA) | 377.00 Ų |
XlogP | 1.50 |
1,2,4,6-Tetragalloyl-beta-D-glucopyranose |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 95.90% | 83.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 95.78% | 95.64% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.92% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 90.98% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.34% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.22% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.87% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.08% | 89.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.50% | 89.34% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.23% | 86.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.23% | 92.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.59% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.89% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 84.45% | 98.95% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.98% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 14464350 |
LOTUS | LTS0268749 |
wikiData | Q105368347 |