Tricoccin S3
Internal ID | 1be09e99-f122-432d-bb81-3d00faddead2 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | 7-(furan-3-yl)-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-ene-5,15,20-trione |
SMILES (Canonical) | CC1(C2CC(=O)C3(C(C2(C=CC(=O)O1)C)CCC4(C35C(O5)C(=O)OC4C6=COC=C6)C)C)C |
SMILES (Isomeric) | CC1(C2CC(=O)C3(C(C2(C=CC(=O)O1)C)CCC4(C35C(O5)C(=O)OC4C6=COC=C6)C)C)C |
InChI | InChI=1S/C26H30O7/c1-22(2)16-12-17(27)25(5)15(23(16,3)9-7-18(28)32-22)6-10-24(4)19(14-8-11-30-13-14)31-21(29)20-26(24,25)33-20/h7-9,11,13,15-16,19-20H,6,10,12H2,1-5H3 |
InChI Key | MAYJEFRPIKEYBL-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C26H30O7 |
Molecular Weight | 454.50 g/mol |
Exact Mass | 454.19915329 g/mol |
Topological Polar Surface Area (TPSA) | 95.30 Ų |
XlogP | 3.20 |
NSC611284 |
3-furyl(pentamethyl)[?]trione |
MAYJEFRPIKEYBL-UHFFFAOYSA-N |
(1R,2R,4S,7S,8S,11R,12R,18R)-7-(furan-3-yl)-1,8,12,17,17-pentamethyl-3,6,16-trioxapentacyclo[9.9.0.0^{2,4.0^{2,8.0^{12,18]icos-13-ene-5,15,20-trione |
1-(3-Furyl)-4b,7,7,11a,13a-pentamethyl-1,6a,7,11a,11b,12,13,13a-octahydrooxireno[2',3':4,4a]isochromeno[6,5-g][2]benzoxepine-3,5,9(3aH,4bH,6H)-trione |
1-(3-Furyl)-4b,7,7,11a,13a-pentamethyl-1,6a,7,11a,11b,12,13,13a-octahydrooxireno[2',3':4,4a]isochromeno[6,5-g][2]benzoxepine-3,5,9(3ah,4bh,6H)-trione # |
![2D Structure of Tricoccin S3 2D Structure of Tricoccin S3](https://plantaedb.com/storage/docs/compounds/2023/11/tricoccin-s3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.47% | 91.11% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 91.70% | 92.97% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.25% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.15% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.95% | 94.75% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 87.70% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.34% | 99.23% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 84.20% | 91.38% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.94% | 100.00% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 83.71% | 88.42% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.62% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.52% | 94.45% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.87% | 96.00% |
CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 82.74% | 91.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.82% | 95.89% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.00% | 96.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Casimiroa edulis |
Citrus × aurantium |
Dictamnus albus |
Dictamnus dasycarpus |
Harrisonia abyssinica |
Harrisonia perforata |
Phellodendron amurense |
PubChem | 500031 |
LOTUS | LTS0167700 |
wikiData | Q105337982 |