n-Isobutyl-2,4-decadienamide
| Internal ID | 3eb8465f-6d0c-48de-885e-a6d8b987e7b5 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | N-(2-methylpropyl)deca-2,4-dienamide |
| SMILES (Canonical) | CCCCCC=CC=CC(=O)NCC(C)C |
| SMILES (Isomeric) | CCCCCC=CC=CC(=O)NCC(C)C |
| InChI | InChI=1S/C14H25NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h8-11,13H,4-7,12H2,1-3H3,(H,15,16) |
| InChI Key | MAGQQZHFHJDIRE-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.35 g/mol |
| Exact Mass | 223.193614421 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 4.40 |
| 109-26-2 |
| N-(2-Methylpropyl)-2,4-Decadienamide |
| 2,4-Decadienamide, N-(2-methylpropyl)- |
| trans-Pellitorin; trans-Pellitorine |
| N-Isobutyldecadienamid |
| DTXSID90864855 |
| N-(2-methylpropyl)deca-2,4-dienamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.74% | 98.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.83% | 97.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.21% | 99.17% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.86% | 89.63% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.25% | 96.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 90.65% | 89.34% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.23% | 93.56% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 88.45% | 95.71% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.28% | 92.86% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.63% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.38% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.35% | 94.45% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.04% | 96.47% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.70% | 96.95% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 85.67% | 87.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.90% | 94.73% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.58% | 85.94% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.58% | 94.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.42% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.70% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.39% | 91.11% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.33% | 90.71% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.27% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 3009280 |
| LOTUS | LTS0009070 |
| wikiData | Q103815861 |