Methyl 3-carbazolecarboxylate
| Internal ID | 5a364cab-9f0c-4372-9d4d-5b91efa9fed7 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | methyl 9H-carbazole-3-carboxylate |
| SMILES (Canonical) | COC(=O)C1=CC2=C(C=C1)NC3=CC=CC=C32 |
| SMILES (Isomeric) | COC(=O)C1=CC2=C(C=C1)NC3=CC=CC=C32 |
| InChI | InChI=1S/C14H11NO2/c1-17-14(16)9-6-7-13-11(8-9)10-4-2-3-5-12(10)15-13/h2-8,15H,1H3 |
| InChI Key | LZXXHWWSVRIDGR-UHFFFAOYSA-N |
| Popularity | 16 references in papers |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.078978594 g/mol |
| Topological Polar Surface Area (TPSA) | 42.10 Ų |
| XlogP | 3.60 |
| Methyl 9H-carbazole-3-carboxylate |
| 97931-41-4 |
| methyl carbazole-3-carboxylate |
| CHEMBL446253 |
| 9H-carbazole-3-carboxylic acid methyl ester |
| Carbazole-3-carboxylic acid, methyl ester (6CI); Methyl 9H-carbazole-3-carboxylate |
| 3-methoxycarbonylcarbazole |
| Methyl3-carbazolecarboxylate |
| SCHEMBL71508 |
| CHEBI:178582 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.68% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.33% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.57% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.09% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.38% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.63% | 93.99% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 84.36% | 92.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.34% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.78% | 90.20% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.15% | 91.49% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.22% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.43% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 504069 |
| NPASS | NPC160381 |
| ChEMBL | CHEMBL446253 |
| LOTUS | LTS0207472 |
| wikiData | Q105160203 |