Lysine, DL-
| Internal ID | 38379df9-655c-4202-a070-8d8b66988e94 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acids |
| IUPAC Name | 2,6-diaminohexanoic acid |
| SMILES (Canonical) | C(CCN)CC(C(=O)O)N |
| SMILES (Isomeric) | C(CCN)CC(C(=O)O)N |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) |
| InChI Key | KDXKERNSBIXSRK-UHFFFAOYSA-N |
| Popularity | 26,307 references in papers |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.105527694 g/mol |
| Topological Polar Surface Area (TPSA) | 89.30 Ų |
| XlogP | -3.00 |
| 70-54-2 |
| 2,6-diaminohexanoic acid |
| Lysine, DL- |
| (RS)-Lysine |
| H-DL-Lys-OH |
| L-Lysine base |
| UNII-AI4RT59273 |
| CCRIS 8600 |
| (+-)-2,6-Diaminohexanoic acid |
| AI4RT59273 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.72% | 96.09% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.53% | 97.21% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.59% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.31% | 99.17% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 87.76% | 93.18% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.93% | 90.20% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 85.30% | 92.29% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 84.33% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.39% | 97.29% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.59% | 91.11% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.74% | 100.00% |
| CHEMBL1795117 | Q8TEK3 | Histone-lysine N-methyltransferase, H3 lysine-79 specific | 80.44% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 866 |
| LOTUS | LTS0141380 |
| wikiData | Q178430 |