Hesperetin
| Internal ID | a80415d4-ea19-43fe-b94a-426a023d27c6 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 4-O-methylated flavonoids |
| IUPAC Name | (2S)-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C2CC(=O)C3=C(C=C(C=C3O2)O)O)O |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)[C@@H]2CC(=O)C3=C(C=C(C=C3O2)O)O)O |
| InChI | InChI=1S/C16H14O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1 |
| InChI Key | AIONOLUJZLIMTK-AWEZNQCLSA-N |
| Popularity | 2,342 references in papers |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 2.40 |
| Atomic LogP (AlogP) | 2.52 |
| H-Bond Acceptor | 6 |
| H-Bond Donor | 3 |
| Rotatable Bonds | 2 |
| Hesperitin |
| 520-33-2 |
| 3',5,7-Trihydroxy-4'-methoxyflavanone |
| (-)-hesperetin |
| 5,7,3'-Trihydroxy-4'-methoxyflavanone |
| (2S)-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| (-)-(S)-hesperetin |
| Eriodictyol 4'-monomethyl ether |
| NSC-57654 |
| FEMA NO. 4313 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9028 | 90.28% |
| Caco-2 | + | 0.8207 | 82.07% |
| Blood Brain Barrier | - | 0.7500 | 75.00% |
| Human oral bioavailability | - | 0.8286 | 82.86% |
| Subcellular localzation | Mitochondria | 0.6551 | 65.51% |
| OATP2B1 inhibitior | - | 0.5904 | 59.04% |
| OATP1B1 inhibitior | + | 0.9581 | 95.81% |
| OATP1B3 inhibitior | + | 0.9701 | 97.01% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | - | 0.8294 | 82.94% |
| P-glycoprotein inhibitior | - | 0.9167 | 91.67% |
| P-glycoprotein substrate | - | 0.9026 | 90.26% |
| CYP3A4 substrate | + | 0.5487 | 54.87% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7429 | 74.29% |
| CYP3A4 inhibition | + | 0.7959 | 79.59% |
| CYP2C9 inhibition | + | 0.8949 | 89.49% |
| CYP2C19 inhibition | + | 0.8994 | 89.94% |
| CYP2D6 inhibition | + | 0.6510 | 65.10% |
| CYP1A2 inhibition | + | 0.9106 | 91.06% |
| CYP2C8 inhibition | + | 0.4504 | 45.04% |
| CYP inhibitory promiscuity | + | 0.7998 | 79.98% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.9900 | 99.00% |
| Carcinogenicity (trinary) | Non-required | 0.5775 | 57.75% |
| Eye corrosion | - | 0.9853 | 98.53% |
| Eye irritation | + | 0.9629 | 96.29% |
| Skin irritation | - | 0.6488 | 64.88% |
| Skin corrosion | - | 0.9295 | 92.95% |
| Ames mutagenesis | - | 0.6200 | 62.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.7259 | 72.59% |
| Micronuclear | + | 0.8459 | 84.59% |
| Hepatotoxicity | - | 0.6218 | 62.18% |
| skin sensitisation | - | 0.9253 | 92.53% |
| Respiratory toxicity | - | 0.6111 | 61.11% |
| Reproductive toxicity | + | 0.9333 | 93.33% |
| Mitochondrial toxicity | + | 0.7500 | 75.00% |
| Nephrotoxicity | + | 0.6431 | 64.31% |
| Acute Oral Toxicity (c) | III | 0.5979 | 59.79% |
| Estrogen receptor binding | + | 0.7878 | 78.78% |
| Androgen receptor binding | + | 0.5318 | 53.18% |
| Thyroid receptor binding | + | 0.7151 | 71.51% |
| Glucocorticoid receptor binding | + | 0.8091 | 80.91% |
| Aromatase binding | + | 0.6516 | 65.16% |
| PPAR gamma | + | 0.8556 | 85.56% |
| Honey bee toxicity | - | 0.7997 | 79.97% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.5449 | 54.49% |
| Fish aquatic toxicity | + | 0.7222 | 72.22% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
12589.3 nM |
Potency |
via CMAUP
|
| CHEMBL3729 | P22748 | Carbonic anhydrase IV |
102.1 nM 102.1 nM |
Ki Ki |
PMID: 26498393
via Super-PRED |
| CHEMBL2326 | P43166 | Carbonic anhydrase VII |
3.3 nM 3.3 nM |
Ki Ki |
PMID: 26498393
via Super-PRED |
| CHEMBL3242 | O43570 | Carbonic anhydrase XII |
454.1 nM 454.1 nM |
Ki Ki |
PMID: 26498393
via Super-PRED |
| CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
25118.9 nM |
Potency |
via CMAUP
|
| CHEMBL2231 | P04798 | Cytochrome P450 1A1 |
2786 nM |
IC50 |
PMID: 20696580
|
| CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
34647 nM |
IC50 |
PMID: 20696580
|
| CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
511 nM 511 nM |
IC50 IC50 |
PMID: 20696580
via Super-PRED |
| CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
7943.3 nM 5011.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
10000 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL289 | P10635 | Cytochrome P450 2D6 |
10000 nM 39810.7 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 |
15848.9 nM 10000 nM 15848.9 nM 10000 nM |
Potency Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP via CMAUP |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV |
280 nM |
IC50 |
via Super-PRED
|
| CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
12589.3 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL262 | P49841 | Glycogen synthase kinase-3 beta |
26900 nM |
IC50 |
DOI: 10.1007/s00044-012-0353-y
|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
5011.9 nM 5011.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL4040 | P28482 | MAP kinase ERK2 |
3981.1 nM |
Potency |
via CMAUP
|
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
5623.4 nM |
Potency |
via CMAUP
|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
6309.6 nM |
Potency |
via CMAUP
|
| CHEMBL3797 | Q13315 | Serine-protein kinase ATM |
39810.7 nM |
Potency |
via CMAUP
|
| CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
2511.9 nM 2511.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.94% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.84% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.43% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.41% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.27% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.73% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.37% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.29% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.03% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.22% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.80% | 86.33% |
| CHEMBL3194 | P02766 | Transthyretin | 86.86% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.69% | 95.89% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.51% | 96.12% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.05% | 98.75% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.77% | 95.78% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.78% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.14% | 90.71% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.57% | 85.14% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.26% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 72281 |
| NPASS | NPC302950 |
| ChEMBL | CHEMBL399121 |
| LOTUS | LTS0087195 |
| wikiData | Q411310 |