Euparone
Internal ID | 3e48f646-fc5d-4f72-a34f-02fae23f7143 |
Taxonomy | Organoheterocyclic compounds > Benzofurans |
IUPAC Name | 1-(5-acetyl-6-hydroxy-1-benzofuran-2-yl)ethanone |
SMILES (Canonical) | CC(=O)C1=CC2=CC(=C(C=C2O1)O)C(=O)C |
SMILES (Isomeric) | CC(=O)C1=CC2=CC(=C(C=C2O1)O)C(=O)C |
InChI | InChI=1S/C12H10O4/c1-6(13)9-3-8-4-11(7(2)14)16-12(8)5-10(9)15/h3-5,15H,1-2H3 |
InChI Key | FOXRXAILTBHLQA-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C12H10O4 |
Molecular Weight | 218.20 g/mol |
Exact Mass | 218.05790880 g/mol |
Topological Polar Surface Area (TPSA) | 67.50 Ų |
XlogP | 2.20 |
53947-86-7 |
2,5-Diacetyl-6-hydroxybenzofuran |
1-(5-acetyl-6-hydroxy-1-benzofuran-2-yl)ethanone |
Ethanone, 1,1'-(6-hydroxy-2,5-benzofurandiyl)bis- |
DTXSID10968748 |
FOXRXAILTBHLQA-UHFFFAOYSA-N |
1,1'-(6-Hydroxy-1-benzofuran-2,5-diyl)di(ethan-1-one) |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.41% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.86% | 94.73% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 88.16% | 94.42% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.68% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.55% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.55% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 84.53% | 98.95% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.17% | 93.65% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.04% | 85.14% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.12% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 104654 |
NPASS | NPC135781 |
LOTUS | LTS0236643 |
wikiData | Q105277222 |