DL-Aspartic acid
| Internal ID | 7694026b-eb73-480b-97ff-3c6f7e475e43 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Aspartic acid and derivatives |
| IUPAC Name | 2-aminobutanedioic acid |
| SMILES (Canonical) | C(C(C(=O)O)N)C(=O)O |
| SMILES (Isomeric) | C(C(C(=O)O)N)C(=O)O |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9) |
| InChI Key | CKLJMWTZIZZHCS-UHFFFAOYSA-N |
| Popularity | 30,872 references in papers |
| Molecular Formula | C4H7NO4 |
| Molecular Weight | 133.10 g/mol |
| Exact Mass | 133.03750770 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | -2.80 |
| 617-45-8 |
| 2-aminobutanedioic acid |
| DL-Aminosuccinic acid |
| DL-Asparagic acid |
| Aspartic acid, DL- |
| DL-Asp-OH |
| Acid D,L-aspart |
| (+-)-Aspartic acid |
| (R,S)-Aspartic acid |
| Aminosuccinic acid |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.03% | 96.09% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.06% | 96.95% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 84.58% | 92.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.38% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.92% | 90.20% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.43% | 90.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.35% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.55% | 98.95% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.05% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 424 |
| LOTUS | LTS0182847 |
| wikiData | Q27109481 |