Demecolcine
Internal ID | 6247a8c2-d391-413e-a389-827715610c85 |
Taxonomy | Hydrocarbon derivatives > Tropones |
IUPAC Name | (7S)-1,2,3,10-tetramethoxy-7-(methylamino)-6,7-dihydro-5H-benzo[a]heptalen-9-one |
SMILES (Canonical) | CNC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC |
SMILES (Isomeric) | CN[C@H]1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC |
InChI | InChI=1S/C21H25NO5/c1-22-15-8-6-12-10-18(25-3)20(26-4)21(27-5)19(12)13-7-9-17(24-2)16(23)11-14(13)15/h7,9-11,15,22H,6,8H2,1-5H3/t15-/m0/s1 |
InChI Key | NNJPGOLRFBJNIW-HNNXBMFYSA-N |
Popularity | 2,078 references in papers |
Molecular Formula | C21H25NO5 |
Molecular Weight | 371.40 g/mol |
Exact Mass | 371.17327290 g/mol |
Topological Polar Surface Area (TPSA) | 66.00 Ų |
XlogP | 1.40 |
Atomic LogP (AlogP) | 2.95 |
H-Bond Acceptor | 6 |
H-Bond Donor | 1 |
Rotatable Bonds | 5 |
colcemid |
477-30-5 |
Colchamine |
(-)-Demecolcine |
Demecolcin |
Reichstein's F |
Colcemide |
Desmecolcine |
Substance F |
N-Deacetyl-N-methylcolchicine |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9966 | 99.66% |
Caco-2 | + | 0.9125 | 91.25% |
Blood Brain Barrier | - | 0.6250 | 62.50% |
Human oral bioavailability | + | 0.7000 | 70.00% |
Subcellular localzation | Nucleus | 0.5081 | 50.81% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9352 | 93.52% |
OATP1B3 inhibitior | + | 0.9572 | 95.72% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.8250 | 82.50% |
BSEP inhibitior | + | 0.8553 | 85.53% |
P-glycoprotein inhibitior | - | 0.6553 | 65.53% |
P-glycoprotein substrate | + | 0.9344 | 93.44% |
CYP3A4 substrate | + | 0.7177 | 71.77% |
CYP2C9 substrate | - | 0.6048 | 60.48% |
CYP2D6 substrate | + | 0.5080 | 50.80% |
CYP3A4 inhibition | - | 0.5093 | 50.93% |
CYP2C9 inhibition | - | 0.9385 | 93.85% |
CYP2C19 inhibition | - | 0.8396 | 83.96% |
CYP2D6 inhibition | - | 0.8911 | 89.11% |
CYP1A2 inhibition | - | 0.8260 | 82.60% |
CYP2C8 inhibition | + | 0.9409 | 94.09% |
CYP inhibitory promiscuity | - | 0.7928 | 79.28% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9300 | 93.00% |
Carcinogenicity (trinary) | Non-required | 0.6931 | 69.31% |
Eye corrosion | - | 0.9866 | 98.66% |
Eye irritation | - | 0.8981 | 89.81% |
Skin irritation | - | 0.7134 | 71.34% |
Skin corrosion | - | 0.9277 | 92.77% |
Ames mutagenesis | - | 0.9600 | 96.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7107 | 71.07% |
Micronuclear | - | 0.5000 | 50.00% |
Hepatotoxicity | - | 0.5948 | 59.48% |
skin sensitisation | - | 0.9064 | 90.64% |
Respiratory toxicity | + | 0.7889 | 78.89% |
Reproductive toxicity | + | 0.8667 | 86.67% |
Mitochondrial toxicity | + | 0.8250 | 82.50% |
Nephrotoxicity | + | 0.7809 | 78.09% |
Acute Oral Toxicity (c) | III | 0.4887 | 48.87% |
Estrogen receptor binding | + | 0.9102 | 91.02% |
Androgen receptor binding | + | 0.8697 | 86.97% |
Thyroid receptor binding | + | 0.8479 | 84.79% |
Glucocorticoid receptor binding | + | 0.8970 | 89.70% |
Aromatase binding | + | 0.5460 | 54.60% |
PPAR gamma | + | 0.6869 | 68.69% |
Honey bee toxicity | - | 0.8585 | 85.85% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | + | 0.5900 | 59.00% |
Fish aquatic toxicity | + | 0.8694 | 86.94% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2362980 | Q06710 | Paired box protein Pax-8 |
<
260 nM |
AC50 |
via CMAUP
|
CHEMBL3401 | O75469 | Pregnane X receptor |
12600 nM 14100 nM |
EC50 EC50 |
PMID: 20966043
PMID: 20966043 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 92.11% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.70% | 96.09% |
CHEMBL2535 | P11166 | Glucose transporter | 91.40% | 98.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.02% | 91.11% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.69% | 90.71% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 90.02% | 93.03% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.49% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.44% | 95.89% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.17% | 96.38% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.56% | 83.82% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 86.17% | 96.86% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 85.76% | 96.09% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 85.64% | 92.98% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.42% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.77% | 91.49% |
CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 83.68% | 82.50% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 83.47% | 91.00% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 83.37% | 91.79% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 83.24% | 95.62% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 83.24% | 92.38% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.23% | 97.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.94% | 99.17% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 82.32% | 96.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.99% | 95.89% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.49% | 96.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.79% | 92.62% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.70% | 96.21% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.58% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 220401 |
NPASS | NPC190931 |
ChEMBL | CHEMBL312862 |
LOTUS | LTS0223323 |
wikiData | Q903666 |