Chlorogenin
Internal ID | 0c628a9b-5e3d-49a2-947b-ff395ce4550b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1R,2S,4S,5'R,6R,7S,8R,9S,12S,13R,16S,18S,19S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16,19-diol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC(C6C5(CCC(C6)O)C)O)C)C)OC1 |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4C[C@@H]([C@@H]6[C@@]5(CC[C@@H](C6)O)C)O)C)C)OC1 |
InChI | InChI=1S/C27H44O4/c1-15-5-10-27(30-14-15)16(2)24-23(31-27)13-20-18-12-22(29)21-11-17(28)6-8-25(21,3)19(18)7-9-26(20,24)4/h15-24,28-29H,5-14H2,1-4H3/t15-,16+,17+,18-,19+,20+,21-,22+,23+,24+,25-,26+,27-/m1/s1 |
InChI Key | PZNPHSFXILSZTM-JUGSJECZSA-N |
Popularity | 3 references in papers |
Molecular Formula | C27H44O4 |
Molecular Weight | 432.60 g/mol |
Exact Mass | 432.32395988 g/mol |
Topological Polar Surface Area (TPSA) | 58.90 Ų |
XlogP | 5.10 |
562-34-5 |
UNII-K8Z178V1DG |
K8Z178V1DG |
5alpha-Spirostan-3beta,6alpha-diol, (25R)- |
(1R,2S,4S,5'R,6R,7S,8R,9S,12S,13R,16S,18S,19S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16,19-diol |
F-Chlorogenin |
CHLOROGENIN [MI] |
SCHEMBL330411 |
CHEMBL2047364 |
DTXSID30903919 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.48% | 96.09% |
CHEMBL204 | P00734 | Thrombin | 91.46% | 96.01% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.36% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.30% | 96.61% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 91.23% | 97.31% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.96% | 100.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.46% | 89.05% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.59% | 82.69% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.07% | 95.58% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.73% | 96.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.49% | 91.11% |
CHEMBL237 | P41145 | Kappa opioid receptor | 85.08% | 98.10% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.17% | 94.45% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.71% | 95.50% |
CHEMBL233 | P35372 | Mu opioid receptor | 83.48% | 97.93% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.43% | 92.94% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.79% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.99% | 89.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.87% | 90.17% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.26% | 92.86% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.08% | 95.89% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.90% | 95.38% |
CHEMBL238 | Q01959 | Dopamine transporter | 80.65% | 95.88% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.55% | 96.77% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.54% | 100.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.44% | 93.04% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.25% | 92.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 12303065 |
NPASS | NPC296734 |
ChEMBL | CHEMBL2047364 |
LOTUS | LTS0081778 |
wikiData | Q27282108 |