Chavicine
Internal ID | 469269b8-cfa3-4fc4-98fa-b4ad362388fa |
Taxonomy | Alkaloids and derivatives |
IUPAC Name | (2Z,4Z)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
SMILES (Canonical) | C1CCN(CC1)C(=O)C=CC=CC2=CC3=C(C=C2)OCO3 |
SMILES (Isomeric) | C1CCN(CC1)C(=O)/C=C\C=C/C2=CC3=C(C=C2)OCO3 |
InChI | InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2-,7-3- |
InChI Key | MXXWOMGUGJBKIW-PORYWJCVSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C17H19NO3 |
Molecular Weight | 285.34 g/mol |
Exact Mass | 285.13649347 g/mol |
Topological Polar Surface Area (TPSA) | 38.80 Ų |
XlogP | 3.50 |
Atomic LogP (AlogP) | 3.00 |
H-Bond Acceptor | 3 |
H-Bond Donor | 0 |
Rotatable Bonds | 3 |
Chavicin |
cis-Piperine |
495-91-0 |
UNII-95JV386FPD |
95JV386FPD |
(Z,Z)-1-(5-(1,3-Benzodioxol-5-yl)-1-oxo-2,4-pentadienyl)piperidine |
Piperidine, 1-(5-(1,3-benzodioxol-5-yl)-1-oxo-2,4-pentadienyl)-, (Z,Z)- |
(Z,Z)-1-[5-(1,3-benzodioxol-5-yl)-1-oxo-2,4-pentadienyl]piperidine |
Piperidine, 1-[5-(1,3-benzodioxol-5-yl)-1-oxo-2,4-pentadienyl]-, (Z,Z)- |
CAS-94-62-2 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9934 | 99.34% |
Caco-2 | + | 0.8147 | 81.47% |
Blood Brain Barrier | + | 0.9250 | 92.50% |
Human oral bioavailability | - | 0.5714 | 57.14% |
Subcellular localzation | Mitochondria | 0.6869 | 68.69% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9543 | 95.43% |
OATP1B3 inhibitior | + | 0.9495 | 94.95% |
MATE1 inhibitior | - | 0.9200 | 92.00% |
OCT2 inhibitior | - | 0.5750 | 57.50% |
BSEP inhibitior | + | 0.6539 | 65.39% |
P-glycoprotein inhibitior | - | 0.4563 | 45.63% |
P-glycoprotein substrate | - | 0.9175 | 91.75% |
CYP3A4 substrate | - | 0.5856 | 58.56% |
CYP2C9 substrate | - | 0.8019 | 80.19% |
CYP2D6 substrate | - | 0.8586 | 85.86% |
CYP3A4 inhibition | + | 0.7959 | 79.59% |
CYP2C9 inhibition | - | 0.9070 | 90.70% |
CYP2C19 inhibition | - | 0.7067 | 70.67% |
CYP2D6 inhibition | + | 0.8307 | 83.07% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | - | 0.8658 | 86.58% |
CYP inhibitory promiscuity | + | 0.8136 | 81.36% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9500 | 95.00% |
Carcinogenicity (trinary) | Non-required | 0.5912 | 59.12% |
Eye corrosion | - | 0.9821 | 98.21% |
Eye irritation | - | 0.5667 | 56.67% |
Skin irritation | - | 0.7202 | 72.02% |
Skin corrosion | - | 0.8834 | 88.34% |
Ames mutagenesis | - | 0.9100 | 91.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.8415 | 84.15% |
Micronuclear | + | 0.5200 | 52.00% |
Hepatotoxicity | + | 0.9250 | 92.50% |
skin sensitisation | - | 0.8223 | 82.23% |
Respiratory toxicity | + | 0.7111 | 71.11% |
Reproductive toxicity | + | 0.8000 | 80.00% |
Mitochondrial toxicity | + | 0.8875 | 88.75% |
Nephrotoxicity | - | 0.7287 | 72.87% |
Acute Oral Toxicity (c) | III | 0.8002 | 80.02% |
Estrogen receptor binding | + | 0.7116 | 71.16% |
Androgen receptor binding | + | 0.9000 | 90.00% |
Thyroid receptor binding | + | 0.8461 | 84.61% |
Glucocorticoid receptor binding | - | 0.7247 | 72.47% |
Aromatase binding | + | 0.9037 | 90.37% |
PPAR gamma | + | 0.6922 | 69.22% |
Honey bee toxicity | - | 0.9389 | 93.89% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | - | 0.5952 | 59.52% |
Fish aquatic toxicity | + | 0.8498 | 84.98% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
10000 nM |
Potency |
via CMAUP
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
11220.2 nM |
Potency |
via CMAUP
|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
10000 nM 10000 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
3162.28 nM |
AC50 |
via CMAUP
|
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
12589.25 nM |
AC50 |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
3981.1 nM 3981.1 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
12589.3 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
14125.4 nM |
Potency |
via CMAUP
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
631 nM 631 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
12589.3 nM |
Potency |
via CMAUP
|
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
10000 nM 10000 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.73% | 96.77% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.91% | 86.33% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 93.49% | 92.51% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.25% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.04% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.02% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.91% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.88% | 96.00% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 89.42% | 83.57% |
CHEMBL2581 | P07339 | Cathepsin D | 87.33% | 98.95% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.32% | 94.80% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 86.03% | 90.24% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.86% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.58% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.54% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 1548912 |
NPASS | NPC255817 |
ChEMBL | CHEMBL1395862 |
LOTUS | LTS0260162 |
wikiData | Q5088510 |