Chamazulene
| Internal ID | 670cc1a1-b36b-4d68-ac71-e4f885e417cf |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Guaianes |
| IUPAC Name | 7-ethyl-1,4-dimethylazulene |
| SMILES (Canonical) | CCC1=CC2=C(C=CC2=C(C=C1)C)C |
| SMILES (Isomeric) | CCC1=CC2=C(C=CC2=C(C=C1)C)C |
| InChI | InChI=1S/C14H16/c1-4-12-7-5-10(2)13-8-6-11(3)14(13)9-12/h5-9H,4H2,1-3H3 |
| InChI Key | GXGJIOMUZAGVEH-UHFFFAOYSA-N |
| Popularity | 615 references in papers |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.125200510 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.40 |
| Chamazulen |
| 7-Ethyl-1,4-dimethylazulene |
| 529-05-5 |
| Camazulene |
| Dimethulene |
| Dimethulen |
| 1,4-Dimethyl-7-ethylazulene |
| Azulene, 7-ethyl-1,4-dimethyl- |
| BA 2784 |
| EINECS 208-449-6 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.78% | 98.95% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 94.58% | 90.24% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 89.84% | 93.65% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.12% | 94.73% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 86.82% | 92.51% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.73% | 96.95% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 85.53% | 83.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.44% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.00% | 96.09% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.65% | 93.31% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.51% | 96.00% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 81.41% | 90.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 10719 |
| NPASS | NPC22760 |
| ChEMBL | CHEMBL495665 |
| LOTUS | LTS0124432 |
| wikiData | Q909088 |