Cepharanthine
Internal ID | f4b504f5-1e3e-45d6-bcb7-5e93f88afd59 |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | (14S,27R)-22,33-dimethoxy-13,28-dimethyl-2,5,7,20-tetraoxa-13,28-diazaoctacyclo[25.6.2.216,19.13,10.121,25.04,8.031,35.014,39]nonatriaconta-1(33),3(39),4(8),9,16(38),17,19(37),21,23,25(36),31,34-dodecaene |
SMILES (Canonical) | CN1CCC2=CC3=C(C4=C2C1CC5=CC=C(C=C5)OC6=C(C=CC(=C6)CC7C8=CC(=C(C=C8CCN7C)OC)O4)OC)OCO3 |
SMILES (Isomeric) | CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=CC=C(C=C5)OC6=C(C=CC(=C6)C[C@@H]7C8=CC(=C(C=C8CCN7C)OC)O4)OC)OCO3 |
InChI | InChI=1S/C37H38N2O6/c1-38-13-11-24-18-31(41-4)33-20-27(24)28(38)16-23-7-10-30(40-3)32(17-23)44-26-8-5-22(6-9-26)15-29-35-25(12-14-39(29)2)19-34-36(37(35)45-33)43-21-42-34/h5-10,17-20,28-29H,11-16,21H2,1-4H3/t28-,29+/m1/s1 |
InChI Key | YVPXVXANRNDGTA-WDYNHAJCSA-N |
Popularity | 538 references in papers |
Molecular Formula | C37H38N2O6 |
Molecular Weight | 606.70 g/mol |
Exact Mass | 606.27298694 g/mol |
Topological Polar Surface Area (TPSA) | 61.90 Ų |
XlogP | 6.50 |
Atomic LogP (AlogP) | 6.87 |
H-Bond Acceptor | 8 |
H-Bond Donor | 0 |
Rotatable Bonds | 2 |
481-49-2 |
Cepharanthin |
(+)-Cepharanthine |
O-Methylcepharanoline |
Cepharantin |
Cepharanthine [JAN] |
C37H38N2O6 |
6',12'-Dimethoxy-2,2'-dimethyl-6,7-(methylenebis(oxy))oxyacanthan |
NSC-623442 |
CCRIS 6539 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9342 | 93.42% |
Caco-2 | + | 0.9313 | 93.13% |
Blood Brain Barrier | + | 0.9000 | 90.00% |
Human oral bioavailability | - | 0.6857 | 68.57% |
Subcellular localzation | Lysosomes | 0.4848 | 48.48% |
OATP2B1 inhibitior | - | 0.8589 | 85.89% |
OATP1B1 inhibitior | + | 0.9413 | 94.13% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.8000 | 80.00% |
OCT2 inhibitior | - | 0.6000 | 60.00% |
BSEP inhibitior | + | 1.0000 | 100.00% |
P-glycoprotein inhibitior | + | 0.9665 | 96.65% |
P-glycoprotein substrate | + | 0.5888 | 58.88% |
CYP3A4 substrate | + | 0.6650 | 66.50% |
CYP2C9 substrate | - | 0.6090 | 60.90% |
CYP2D6 substrate | + | 0.6093 | 60.93% |
CYP3A4 inhibition | - | 0.8308 | 83.08% |
CYP2C9 inhibition | - | 0.8647 | 86.47% |
CYP2C19 inhibition | - | 0.6496 | 64.96% |
CYP2D6 inhibition | + | 0.5611 | 56.11% |
CYP1A2 inhibition | - | 0.6778 | 67.78% |
CYP2C8 inhibition | + | 0.4530 | 45.30% |
CYP inhibitory promiscuity | - | 0.6742 | 67.42% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.5923 | 59.23% |
Eye corrosion | - | 0.9888 | 98.88% |
Eye irritation | - | 0.9475 | 94.75% |
Skin irritation | - | 0.8027 | 80.27% |
Skin corrosion | - | 0.9519 | 95.19% |
Ames mutagenesis | + | 0.9100 | 91.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.9549 | 95.49% |
Micronuclear | + | 0.5600 | 56.00% |
Hepatotoxicity | - | 0.9625 | 96.25% |
skin sensitisation | - | 0.8764 | 87.64% |
Respiratory toxicity | + | 0.8000 | 80.00% |
Reproductive toxicity | + | 0.8778 | 87.78% |
Mitochondrial toxicity | + | 0.7750 | 77.50% |
Nephrotoxicity | - | 0.7179 | 71.79% |
Acute Oral Toxicity (c) | III | 0.7902 | 79.02% |
Estrogen receptor binding | + | 0.6826 | 68.26% |
Androgen receptor binding | + | 0.7361 | 73.61% |
Thyroid receptor binding | + | 0.6450 | 64.50% |
Glucocorticoid receptor binding | + | 0.8831 | 88.31% |
Aromatase binding | - | 0.4834 | 48.34% |
PPAR gamma | + | 0.6100 | 61.00% |
Honey bee toxicity | - | 0.6990 | 69.90% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | + | 0.6800 | 68.00% |
Fish aquatic toxicity | + | 0.8910 | 89.10% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
89.1 nM 89.1 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
3981.1 nM |
Potency |
via CMAUP
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
15848.9 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.43% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.04% | 96.77% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 94.38% | 89.62% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 93.61% | 91.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.16% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.07% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.47% | 94.45% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.40% | 93.40% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.22% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 89.14% | 98.95% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 88.92% | 90.95% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.41% | 95.78% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 87.25% | 95.62% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 86.99% | 82.38% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 86.34% | 82.67% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.16% | 85.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.01% | 92.62% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 84.97% | 96.86% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.44% | 86.33% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 84.34% | 92.38% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.34% | 100.00% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 83.83% | 97.31% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.70% | 95.89% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.64% | 91.11% |
CHEMBL2535 | P11166 | Glucose transporter | 83.28% | 98.75% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.07% | 89.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.40% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.45% | 89.00% |
CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 80.32% | 99.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 10206 |
NPASS | NPC73492 |
ChEMBL | CHEMBL449782 |
LOTUS | LTS0128547 |
wikiData | Q15410888 |