Apigenin-6-C-glucoside-7-O-glucoside
Internal ID | 487a5240-6689-494a-a3d5-7620a4a7883a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=CC(=O)C3=C(C(=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)C5C(C(C(C(O5)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=CC(=O)C3=C(C(=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)C5C(C(C(C(O5)CO)O)O)O)O)O |
InChI | InChI=1S/C27H30O15/c28-7-15-19(32)22(35)24(37)26(40-15)18-14(41-27-25(38)23(36)20(33)16(8-29)42-27)6-13-17(21(18)34)11(31)5-12(39-13)9-1-3-10(30)4-2-9/h1-6,15-16,19-20,22-30,32-38H,7-8H2 |
InChI Key | HGUVPEBGCAVWID-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C27H30O15 |
Molecular Weight | 594.50 g/mol |
Exact Mass | 594.15847025 g/mol |
Topological Polar Surface Area (TPSA) | 256.00 Ų |
XlogP | -1.60 |
SCHEMBL15689917 |
NCGC00163618-01 |
FT-0645085 |
Q7421004 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.40% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.00% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.95% | 94.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.55% | 96.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.38% | 89.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 92.49% | 94.45% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 91.26% | 83.57% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.89% | 85.14% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.86% | 95.78% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.81% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.64% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.37% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.84% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.69% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.13% | 97.09% |
CHEMBL3194 | P02766 | Transthyretin | 83.87% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.09% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.58% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.15% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bombax ceiba |
Bryonia alba |
Cucumis sativus |
Dianthus japonicus |
Hordeum vulgare |
Justicia canbyi |
Saponaria officinalis |
Vitex lucens |
PubChem | 4636593 |
LOTUS | LTS0131887 |
wikiData | Q7421004 |