(1S,5R,6S,8R,9S,13S,16S)-11-ethyl-13-(hydroxymethyl)-4,6,16,18-tetramethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-8,9-diol
Internal ID | 060768ef-d316-4ebd-afea-16340a597157 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Aconitane-type diterpenoid alkaloids |
IUPAC Name | (1S,5R,6S,8R,9S,13S,16S)-11-ethyl-13-(hydroxymethyl)-4,6,16,18-tetramethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-8,9-diol |
SMILES (Canonical) | CCN1CC2(CCC(C34C2C(C(C31)(C5(CC(C6CC4C5C6OC)OC)O)O)OC)OC)CO |
SMILES (Isomeric) | CCN1C[C@@]2(CC[C@@H]([C@@]34C2C([C@@](C31)([C@]5(C[C@@H]([C@H]6CC4C5C6OC)OC)O)O)OC)OC)CO |
InChI | InChI=1S/C25H41NO7/c1-6-26-11-22(12-27)8-7-16(31-3)24-14-9-13-15(30-2)10-23(28,17(14)18(13)32-4)25(29,21(24)26)20(33-5)19(22)24/h13-21,27-29H,6-12H2,1-5H3/t13-,14?,15+,16+,17?,18?,19?,20?,21?,22+,23-,24+,25-/m1/s1 |
InChI Key | YOTUXHIWBVZAJQ-URABJAIZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H41NO7 |
Molecular Weight | 467.60 g/mol |
Exact Mass | 467.28830265 g/mol |
Topological Polar Surface Area (TPSA) | 101.00 Ų |
XlogP | -0.60 |
There are no found synonyms. |
![2D Structure of (1S,5R,6S,8R,9S,13S,16S)-11-ethyl-13-(hydroxymethyl)-4,6,16,18-tetramethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-8,9-diol 2D Structure of (1S,5R,6S,8R,9S,13S,16S)-11-ethyl-13-(hydroxymethyl)-4,6,16,18-tetramethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-8,9-diol](https://plantaedb.com/storage/docs/compounds/2023/11/70de4370-851f-11ee-a68b-1d0847a1bd7d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.94% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.67% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.00% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.89% | 95.93% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 88.80% | 89.63% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.47% | 96.38% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 88.25% | 95.36% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.94% | 94.45% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.49% | 95.58% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.41% | 85.14% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.57% | 96.61% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.33% | 91.03% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.59% | 97.28% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.76% | 92.94% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.66% | 92.62% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.36% | 97.14% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 83.00% | 92.38% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.99% | 97.79% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.85% | 100.00% |
CHEMBL3820 | P35557 | Hexokinase type IV | 82.81% | 91.96% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.54% | 100.00% |
CHEMBL204 | P00734 | Thrombin | 82.31% | 96.01% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.20% | 95.89% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.44% | 89.62% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 80.60% | 88.42% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.54% | 93.03% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.47% | 100.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.46% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 145994515 |
LOTUS | LTS0126220 |
wikiData | Q104252965 |