6''-Acetylapiin
Internal ID | 9bc1688b-0025-4e89-8885-f1c625ecdf5d |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [(2R,3S,4S,5R,6S)-5-[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-3,4-dihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=CC3=O)C4=CC=C(C=C4)O)O)OC5C(C(CO5)(CO)O)O)O)O |
SMILES (Isomeric) | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=CC(=C3C(=C2)OC(=CC3=O)C4=CC=C(C=C4)O)O)O[C@H]5[C@@H]([C@](CO5)(CO)O)O)O)O |
InChI | InChI=1S/C28H30O15/c1-12(30)38-9-20-22(34)23(35)24(43-27-25(36)28(37,10-29)11-39-27)26(42-20)40-15-6-16(32)21-17(33)8-18(41-19(21)7-15)13-2-4-14(31)5-3-13/h2-8,20,22-27,29,31-32,34-37H,9-11H2,1H3/t20-,22-,23+,24-,25+,26-,27+,28-/m1/s1 |
InChI Key | IJUKPRHUCJJFTO-HMZWGCPASA-N |
Popularity | 11 references in papers |
Molecular Formula | C28H30O15 |
Molecular Weight | 606.50 g/mol |
Exact Mass | 606.15847025 g/mol |
Topological Polar Surface Area (TPSA) | 231.00 Ų |
XlogP | -0.30 |
[(2R,3S,4S,5R,6S)-5-[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-3,4-dihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
CHEBI:191677 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.90% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.00% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.89% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.58% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.75% | 91.49% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.79% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.04% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.56% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.35% | 86.33% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 88.87% | 97.28% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.83% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.58% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.89% | 94.73% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.60% | 94.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.49% | 99.23% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.07% | 86.92% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.04% | 91.19% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.42% | 92.50% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.27% | 96.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.92% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.51% | 90.71% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 82.12% | 80.33% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.67% | 95.71% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.51% | 97.21% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.29% | 95.83% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.68% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 10531745 |
NPASS | NPC134730 |
LOTUS | LTS0064870 |
wikiData | Q105114140 |