5,6,7,8-tetrahydro-3H-pyrrolizin-1-ylmethyl 2-hydroxy-2-(1-hydroxyethyl)-3-methylbutanoate
Internal ID | 67a93fa8-62da-41d1-bc47-b179ccf1e3a9 |
Taxonomy | Alkaloids and derivatives |
IUPAC Name | 5,6,7,8-tetrahydro-3H-pyrrolizin-1-ylmethyl 2-hydroxy-2-(1-hydroxyethyl)-3-methylbutanoate |
SMILES (Canonical) | CC(C)C(C(C)O)(C(=O)OCC1=CCN2C1CCC2)O |
SMILES (Isomeric) | CC(C)C(C(C)O)(C(=O)OCC1=CCN2C1CCC2)O |
InChI | InChI=1S/C15H25NO4/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16/h6,10-11,13,17,19H,4-5,7-9H2,1-3H3 |
InChI Key | DRVWTOSBCBKXOR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H25NO4 |
Molecular Weight | 283.36 g/mol |
Exact Mass | 283.17835828 g/mol |
Topological Polar Surface Area (TPSA) | 70.00 Ų |
XlogP | 0.50 |
NSC-89938 |
5,6,7,8-tetrahydro-3H-pyrrolizin-1-ylmethyl 2-hydroxy-2-(1-hydroxyethyl)-3-methylbutanoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.61% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.57% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 97.75% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.41% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.34% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.84% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.82% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.70% | 95.56% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.41% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.15% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.40% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.33% | 93.03% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.30% | 90.24% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.98% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.06% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 259729 |
LOTUS | LTS0099727 |
wikiData | Q104987677 |