5,5,8a-Trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarbaldehyde
Internal ID | 6b9547b5-db2c-4457-9928-6667c8d7af73 |
Taxonomy | Organic oxygen compounds > Organic oxides |
IUPAC Name | 5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-1,2-dicarbaldehyde |
SMILES (Canonical) | CC1(CCCC2(C1CC=C(C2C=O)C=O)C)C |
SMILES (Isomeric) | CC1(CCCC2(C1CC=C(C2C=O)C=O)C)C |
InChI | InChI=1S/C15H22O2/c1-14(2)7-4-8-15(3)12(10-17)11(9-16)5-6-13(14)15/h5,9-10,12-13H,4,6-8H2,1-3H3 |
InChI Key | AZJUJOFIHHNCSV-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H22O2 |
Molecular Weight | 234.33 g/mol |
Exact Mass | 234.161979940 g/mol |
Topological Polar Surface Area (TPSA) | 34.10 Ų |
XlogP | 3.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL6007 | O75762 | Transient receptor potential cation channel subfamily A member 1 |
59 nM |
EC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.29% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.59% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.97% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.43% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.05% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.44% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.24% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5080908 |
LOTUS | LTS0132876 |
wikiData | Q104921751 |