methyl (5Z)-5-ethylidene-4-[2-[2-(4-hydroxyphenyl)ethoxy]-2-oxoethyl]-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate
Internal ID | 72e85529-8bf4-4b88-b2a8-1a364f5d816d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | methyl (5Z)-5-ethylidene-4-[2-[2-(4-hydroxyphenyl)ethoxy]-2-oxoethyl]-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate |
SMILES (Canonical) | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OCCC3=CC=C(C=C3)O |
SMILES (Isomeric) | C/C=C\1/C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OCCC3=CC=C(C=C3)O |
InChI | InChI=1S/C25H32O12/c1-3-15-16(10-19(28)34-9-8-13-4-6-14(27)7-5-13)17(23(32)33-2)12-35-24(15)37-25-22(31)21(30)20(29)18(11-26)36-25/h3-7,12,16,18,20-22,24-27,29-31H,8-11H2,1-2H3/b15-3- |
InChI Key | GMQXOLRKJQWPNB-CQPUUCJISA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H32O12 |
Molecular Weight | 524.50 g/mol |
Exact Mass | 524.18937645 g/mol |
Topological Polar Surface Area (TPSA) | 181.00 Ų |
XlogP | -0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.80% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.97% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.91% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.17% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 92.13% | 98.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.79% | 86.92% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.59% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.80% | 94.73% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 88.66% | 95.64% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 86.15% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.33% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.23% | 95.89% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.52% | 97.79% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.25% | 94.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.25% | 94.33% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.58% | 96.90% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.17% | 96.00% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.58% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 14136858 |
LOTUS | LTS0042054 |
wikiData | Q104667374 |