4',5-Dihydroxy-7-glucosyloxyflavanone
Internal ID | b0f4daa2-885c-4516-9da2-94564b782618 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | (2S)-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C(C(C(O3)CO)O)O)O)C4=CC=C(C=C4)O |
SMILES (Isomeric) | C1[C@H](OC2=CC(=CC(=C2C1=O)O)O[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)CO)O)O)O)C4=CC=C(C=C4)O |
InChI | InChI=1S/C21H22O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-6,14,16,18-24,26-28H,7-8H2/t14-,16-,18-,19+,20-,21-/m0/s1 |
InChI Key | DLIKSSGEMUFQOK-PRRLNRMFSA-N |
Popularity | 7 references in papers |
Molecular Formula | C21H22O10 |
Molecular Weight | 434.40 g/mol |
Exact Mass | 434.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 0.60 |
4',5-dihydroxy-7-glucosyloxyflavanone |
529-55-5 |
A917901 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.47% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.61% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.29% | 98.95% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.35% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.99% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.27% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.54% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.32% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.12% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.01% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.88% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.59% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.80% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.43% | 99.17% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.28% | 85.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.12% | 86.33% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.29% | 94.80% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.01% | 95.78% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.91% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anisomeles indica |
Citrus × aurantium |
Cuscuta reflexa |
Erythroxylum rufum |
Hydrangea macrophylla |
Momordica foetida |
Pelargonium reniforme |
Prunus avium |
Prunus davidiana |
Salix caprea |
Vaccinium macrocarpon |
PubChem | 124300887 |
LOTUS | LTS0055196 |
wikiData | Q104253012 |